+
+A tiny JavaScript debugging utility modelled after Node.js core's debugging
+technique. Works in Node.js and web browsers.
+
+## Installation
+
+```bash
+$ npm install debug
+```
+
+## Usage
+
+`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
+
+Example [_app.js_](./examples/node/app.js):
+
+```js
+var debug = require('debug')('http')
+ , http = require('http')
+ , name = 'My App';
+
+// fake app
+
+debug('booting %o', name);
+
+http.createServer(function(req, res){
+ debug(req.method + ' ' + req.url);
+ res.end('hello\n');
+}).listen(3000, function(){
+ debug('listening');
+});
+
+// fake worker of some kind
+
+require('./worker');
+```
+
+Example [_worker.js_](./examples/node/worker.js):
+
+```js
+var a = require('debug')('worker:a')
+ , b = require('debug')('worker:b');
+
+function work() {
+ a('doing lots of uninteresting work');
+ setTimeout(work, Math.random() * 1000);
+}
+
+work();
+
+function workb() {
+ b('doing some work');
+ setTimeout(workb, Math.random() * 2000);
+}
+
+workb();
+```
+
+The `DEBUG` environment variable is then used to enable these based on space or
+comma-delimited names.
+
+Here are some examples:
+
+
+
+
+
+#### Windows command prompt notes
+
+##### CMD
+
+On Windows the environment variable is set using the `set` command.
+
+```cmd
+set DEBUG=*,-not_this
+```
+
+Example:
+
+```cmd
+set DEBUG=* & node app.js
+```
+
+##### PowerShell (VS Code default)
+
+PowerShell uses different syntax to set environment variables.
+
+```cmd
+$env:DEBUG = "*,-not_this"
+```
+
+Example:
+
+```cmd
+$env:DEBUG='app';node app.js
+```
+
+Then, run the program to be debugged as usual.
+
+npm script example:
+```js
+ "windowsDebug": "@powershell -Command $env:DEBUG='*';node app.js",
+```
+
+## Namespace Colors
+
+Every debug instance has a color generated for it based on its namespace name.
+This helps when visually parsing the debug output to identify which debug instance
+a debug line belongs to.
+
+#### Node.js
+
+In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
+the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
+otherwise debug will only use a small handful of basic colors.
+
+
+
+#### Web Browser
+
+Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+option. These are WebKit web inspectors, Firefox ([since version
+31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+and the Firebug plugin for Firefox (any version).
+
+
+
+
+## Millisecond diff
+
+When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+
+
+When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
+
+
+
+
+## Conventions
+
+If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output.
+
+## Wildcards
+
+The `*` character may be used as a wildcard. Suppose for example your library has
+debuggers named "connect:bodyParser", "connect:compress", "connect:session",
+instead of listing all three with
+`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
+`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+You can also exclude specific debuggers by prefixing them with a "-" character.
+For example, `DEBUG=*,-connect:*` would include all debuggers except those
+starting with "connect:".
+
+## Environment Variables
+
+When running through Node.js, you can set a few environment variables that will
+change the behavior of the debug logging:
+
+| Name | Purpose |
+|-----------|-------------------------------------------------|
+| `DEBUG` | Enables/disables specific debugging namespaces. |
+| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY). |
+| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
+| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
+
+
+__Note:__ The environment variables beginning with `DEBUG_` end up being
+converted into an Options object that gets used with `%o`/`%O` formatters.
+See the Node.js documentation for
+[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+for the complete list.
+
+## Formatters
+
+Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
+Below are the officially supported formatters:
+
+| Formatter | Representation |
+|-----------|----------------|
+| `%O` | Pretty-print an Object on multiple lines. |
+| `%o` | Pretty-print an Object all on a single line. |
+| `%s` | String. |
+| `%d` | Number (both integer and float). |
+| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
+| `%%` | Single percent sign ('%'). This does not consume an argument. |
+
+
+### Custom formatters
+
+You can add custom formatters by extending the `debug.formatters` object.
+For example, if you wanted to add support for rendering a Buffer as hex with
+`%h`, you could do something like:
+
+```js
+const createDebug = require('debug')
+createDebug.formatters.h = (v) => {
+ return v.toString('hex')
+}
+
+// …elsewhere
+const debug = createDebug('foo')
+debug('this is hex: %h', new Buffer('hello world'))
+// foo this is hex: 68656c6c6f20776f726c6421 +0ms
+```
+
+
+## Browser Support
+
+You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+if you don't want to build it yourself.
+
+Debug's enable state is currently persisted by `localStorage`.
+Consider the situation shown below where you have `worker:a` and `worker:b`,
+and wish to debug both. You can enable this using `localStorage.debug`:
+
+```js
+localStorage.debug = 'worker:*'
+```
+
+And then refresh the page.
+
+```js
+a = debug('worker:a');
+b = debug('worker:b');
+
+setInterval(function(){
+ a('doing some work');
+}, 1000);
+
+setInterval(function(){
+ b('doing some work');
+}, 1200);
+```
+
+In Chromium-based web browsers (e.g. Brave, Chrome, and Electron), the JavaScript console will—by default—only show messages logged by `debug` if the "Verbose" log level is _enabled_.
+
+
+
+## Output streams
+
+ By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
+
+Example [_stdout.js_](./examples/node/stdout.js):
+
+```js
+var debug = require('debug');
+var error = debug('app:error');
+
+// by default stderr is used
+error('goes to stderr!');
+
+var log = debug('app:log');
+// set this namespace to log via console.log
+log.log = console.log.bind(console); // don't forget to bind to console!
+log('goes to stdout');
+error('still goes to stderr!');
+
+// set all output to go via console.info
+// overrides all per-namespace log settings
+debug.log = console.info.bind(console);
+error('now goes to stdout via console.info');
+log('still goes to stdout, but via console.info now');
+```
+
+## Extend
+You can simply extend debugger
+```js
+const log = require('debug')('auth');
+
+//creates new debug instance with extended namespace
+const logSign = log.extend('sign');
+const logLogin = log.extend('login');
+
+log('hello'); // auth hello
+logSign('hello'); //auth:sign hello
+logLogin('hello'); //auth:login hello
+```
+
+## Set dynamically
+
+You can also enable debug dynamically by calling the `enable()` method :
+
+```js
+let debug = require('debug');
+
+console.log(1, debug.enabled('test'));
+
+debug.enable('test');
+console.log(2, debug.enabled('test'));
+
+debug.disable();
+console.log(3, debug.enabled('test'));
+
+```
+
+print :
+```
+1 false
+2 true
+3 false
+```
+
+Usage :
+`enable(namespaces)`
+`namespaces` can include modes separated by a colon and wildcards.
+
+Note that calling `enable()` completely overrides previously set DEBUG variable :
+
+```
+$ DEBUG=foo node -e 'var dbg = require("debug"); dbg.enable("bar"); console.log(dbg.enabled("foo"))'
+=> false
+```
+
+`disable()`
+
+Will disable all namespaces. The functions returns the namespaces currently
+enabled (and skipped). This can be useful if you want to disable debugging
+temporarily without knowing what was enabled to begin with.
+
+For example:
+
+```js
+let debug = require('debug');
+debug.enable('foo:*,-foo:bar');
+let namespaces = debug.disable();
+debug.enable(namespaces);
+```
+
+Note: There is no guarantee that the string will be identical to the initial
+enable string, but semantically they will be identical.
+
+## Checking whether a debug target is enabled
+
+After you've created a debug instance, you can determine whether or not it is
+enabled by checking the `enabled` property:
+
+```javascript
+const debug = require('debug')('http');
+
+if (debug.enabled) {
+ // do stuff...
+}
+```
+
+You can also manually toggle this property to force the debug instance to be
+enabled or disabled.
+
+## Usage in child processes
+
+Due to the way `debug` detects if the output is a TTY or not, colors are not shown in child processes when `stderr` is piped. A solution is to pass the `DEBUG_COLORS=1` environment variable to the child process.
+For example:
+
+```javascript
+worker = fork(WORKER_WRAP_PATH, [workerPath], {
+ stdio: [
+ /* stdin: */ 0,
+ /* stdout: */ 'pipe',
+ /* stderr: */ 'pipe',
+ 'ipc',
+ ],
+ env: Object.assign({}, process.env, {
+ DEBUG_COLORS: 1 // without this settings, colors won't be shown
+ }),
+});
+
+worker.stderr.pipe(process.stderr, { end: false });
+```
+
+
+## Authors
+
+ - TJ Holowaychuk
+ - Nathan Rajlich
+ - Andrew Rhyne
+ - Josh Junon
+
+## Backers
+
+Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+## Sponsors
+
+Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)]
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca>
+Copyright (c) 2018-2021 Josh Junon
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node/node_modules/agent-base/node_modules/debug/package.json b/node/node_modules/agent-base/node_modules/debug/package.json
new file mode 100644
index 0000000000000000000000000000000000000000..3bcdc242fc0675883ce46ba5dca919d116c46a83
--- /dev/null
+++ b/node/node_modules/agent-base/node_modules/debug/package.json
@@ -0,0 +1,59 @@
+{
+ "name": "debug",
+ "version": "4.3.4",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/debug-js/debug.git"
+ },
+ "description": "Lightweight debugging utility for Node.js and the browser",
+ "keywords": [
+ "debug",
+ "log",
+ "debugger"
+ ],
+ "files": [
+ "src",
+ "LICENSE",
+ "README.md"
+ ],
+ "author": "Josh Junon + +## Features + +- Integers and decimals +- Simple API but full-featured +- Faster, smaller, and perhaps easier to use than JavaScript versions of Java's BigDecimal +- 8 KB minified and gzipped +- Replicates the `toExponential`, `toFixed`, `toPrecision` and `toString` methods of JavaScript's Number type +- Includes a `toFraction` and a correctly-rounded `squareRoot` method +- Supports cryptographically-secure pseudo-random number generation +- No dependencies +- Wide platform compatibility: uses JavaScript 1.5 (ECMAScript 3) features only +- Comprehensive [documentation](http://mikemcl.github.io/bignumber.js/) and test set + + + +If a smaller and simpler library is required see [big.js](https://github.com/MikeMcl/big.js/). +It's less than half the size but only works with decimal numbers and only has half the methods. +It also has fewer configuration options than this library, and does not allow `NaN` or `Infinity`. + +See also [decimal.js](https://github.com/MikeMcl/decimal.js/), which among other things adds support for non-integer powers, and performs all operations to a specified number of significant digits. + +## Load + +The library is the single JavaScript file *bignumber.js* or ES module *bignumber.mjs*. + +### Browser + +```html + +``` + +> ES module + +```html + +``` + +### [Node.js](http://nodejs.org) + +```bash +npm install bignumber.js +``` + +```javascript +const BigNumber = require('bignumber.js'); +``` + +> ES module + +```javascript +import BigNumber from "bignumber.js"; +import { BigNumber } from "./node_modules/bignumber.js/bignumber.mjs"; +``` + +### [Deno](https://deno.land/) + +```javascript +import BigNumber from 'https://raw.githubusercontent.com/mikemcl/bignumber.js/v9.1.2/bignumber.mjs'; +import BigNumber from 'https://unpkg.com/bignumber.js@latest/bignumber.mjs'; +``` + +## Use + +The library exports a single constructor function, [`BigNumber`](http://mikemcl.github.io/bignumber.js/#bignumber), which accepts a value of type Number, String or BigNumber, + +```javascript +let x = new BigNumber(123.4567); +let y = BigNumber('123456.7e-3'); +let z = new BigNumber(x); +x.isEqualTo(y) && y.isEqualTo(z) && x.isEqualTo(z); // true +``` + +To get the string value of a BigNumber use [`toString()`](http://mikemcl.github.io/bignumber.js/#toS) or [`toFixed()`](http://mikemcl.github.io/bignumber.js/#toFix). Using `toFixed()` prevents exponential notation being returned, no matter how large or small the value. + +```javascript +let x = new BigNumber('1111222233334444555566'); +x.toString(); // "1.111222233334444555566e+21" +x.toFixed(); // "1111222233334444555566" +``` + +If the limited precision of Number values is not well understood, it is recommended to create BigNumbers from String values rather than Number values to avoid a potential loss of precision. + +*In all further examples below, `let`, semicolons and `toString` calls are not shown. If a commented-out value is in quotes it means `toString` has been called on the preceding expression.* + +```javascript +// Precision loss from using numeric literals with more than 15 significant digits. +new BigNumber(1.0000000000000001) // '1' +new BigNumber(88259496234518.57) // '88259496234518.56' +new BigNumber(99999999999999999999) // '100000000000000000000' + +// Precision loss from using numeric literals outside the range of Number values. +new BigNumber(2e+308) // 'Infinity' +new BigNumber(1e-324) // '0' + +// Precision loss from the unexpected result of arithmetic with Number values. +new BigNumber(0.7 + 0.1) // '0.7999999999999999' +``` + +When creating a BigNumber from a Number, note that a BigNumber is created from a Number's decimal `toString()` value not from its underlying binary value. If the latter is required, then pass the Number's `toString(2)` value and specify base 2. + +```javascript +new BigNumber(Number.MAX_VALUE.toString(2), 2) +``` + +BigNumbers can be created from values in bases from 2 to 36. See [`ALPHABET`](http://mikemcl.github.io/bignumber.js/#alphabet) to extend this range. + +```javascript +a = new BigNumber(1011, 2) // "11" +b = new BigNumber('zz.9', 36) // "1295.25" +c = a.plus(b) // "1306.25" +``` + +*Performance is better if base 10 is NOT specified for decimal values. Only specify base 10 when you want to limit the number of decimal places of the input value to the current [`DECIMAL_PLACES`](http://mikemcl.github.io/bignumber.js/#decimal-places) setting.* + +A BigNumber is immutable in the sense that it is not changed by its methods. + +```javascript +0.3 - 0.1 // 0.19999999999999998 +x = new BigNumber(0.3) +x.minus(0.1) // "0.2" +x // "0.3" +``` + +The methods that return a BigNumber can be chained. + +```javascript +x.dividedBy(y).plus(z).times(9) +x.times('1.23456780123456789e+9').plus(9876.5432321).dividedBy('4444562598.111772').integerValue() +``` + +Some of the longer method names have a shorter alias. + +```javascript +x.squareRoot().dividedBy(y).exponentiatedBy(3).isEqualTo(x.sqrt().div(y).pow(3)) // true +x.modulo(y).multipliedBy(z).eq(x.mod(y).times(z)) // true +``` + +As with JavaScript's Number type, there are [`toExponential`](http://mikemcl.github.io/bignumber.js/#toE), [`toFixed`](http://mikemcl.github.io/bignumber.js/#toFix) and [`toPrecision`](http://mikemcl.github.io/bignumber.js/#toP) methods. + +```javascript +x = new BigNumber(255.5) +x.toExponential(5) // "2.55500e+2" +x.toFixed(5) // "255.50000" +x.toPrecision(5) // "255.50" +x.toNumber() // 255.5 +``` + + A base can be specified for [`toString`](http://mikemcl.github.io/bignumber.js/#toS). + +*Performance is better if base 10 is NOT specified, i.e. use `toString()` not `toString(10)`. Only specify base 10 when you want to limit the number of decimal places of the string to the current [`DECIMAL_PLACES`](http://mikemcl.github.io/bignumber.js/#decimal-places) setting.* + + ```javascript + x.toString(16) // "ff.8" + ``` + +There is a [`toFormat`](http://mikemcl.github.io/bignumber.js/#toFor) method which may be useful for internationalisation. + +```javascript +y = new BigNumber('1234567.898765') +y.toFormat(2) // "1,234,567.90" +``` + +The maximum number of decimal places of the result of an operation involving division (i.e. a division, square root, base conversion or negative power operation) is set using the `set` or `config` method of the `BigNumber` constructor. + +The other arithmetic operations always give the exact result. + +```javascript +BigNumber.set({ DECIMAL_PLACES: 10, ROUNDING_MODE: 4 }) + +x = new BigNumber(2) +y = new BigNumber(3) +z = x.dividedBy(y) // "0.6666666667" +z.squareRoot() // "0.8164965809" +z.exponentiatedBy(-3) // "3.3749999995" +z.toString(2) // "0.1010101011" +z.multipliedBy(z) // "0.44444444448888888889" +z.multipliedBy(z).decimalPlaces(10) // "0.4444444445" +``` + +There is a [`toFraction`](http://mikemcl.github.io/bignumber.js/#toFr) method with an optional *maximum denominator* argument + +```javascript +y = new BigNumber(355) +pi = y.dividedBy(113) // "3.1415929204" +pi.toFraction() // [ "7853982301", "2500000000" ] +pi.toFraction(1000) // [ "355", "113" ] +``` + +and [`isNaN`](http://mikemcl.github.io/bignumber.js/#isNaN) and [`isFinite`](http://mikemcl.github.io/bignumber.js/#isF) methods, as `NaN` and `Infinity` are valid `BigNumber` values. + +```javascript +x = new BigNumber(NaN) // "NaN" +y = new BigNumber(Infinity) // "Infinity" +x.isNaN() && !y.isNaN() && !x.isFinite() && !y.isFinite() // true +``` + +The value of a BigNumber is stored in a decimal floating point format in terms of a coefficient, exponent and sign. + +```javascript +x = new BigNumber(-123.456); +x.c // [ 123, 45600000000000 ] coefficient (i.e. significand) +x.e // 2 exponent +x.s // -1 sign +``` + +For advanced usage, multiple BigNumber constructors can be created, each with its own independent configuration. + +```javascript +// Set DECIMAL_PLACES for the original BigNumber constructor +BigNumber.set({ DECIMAL_PLACES: 10 }) + +// Create another BigNumber constructor, optionally passing in a configuration object +BN = BigNumber.clone({ DECIMAL_PLACES: 5 }) + +x = new BigNumber(1) +y = new BN(1) + +x.div(3) // '0.3333333333' +y.div(3) // '0.33333' +``` + +To avoid having to call `toString` or `valueOf` on a BigNumber to get its value in the Node.js REPL or when using `console.log` use + +```javascript +BigNumber.prototype[require('util').inspect.custom] = BigNumber.prototype.valueOf; +``` + +For further information see the [API](http://mikemcl.github.io/bignumber.js/) reference in the *doc* directory. + +## Test + +The *test/modules* directory contains the test scripts for each method. + +The tests can be run with Node.js or a browser. For Node.js use + +```bash +npm test +``` + +or + +```bash +node test/test +``` + +To test a single method, use, for example + +```bash +node test/methods/toFraction +``` + +For the browser, open *test/test.html*. + +## Minify + +To minify using, for example, [terser](https://github.com/terser/terser) + +```bash +npm install -g terser +``` + +```bash +terser big.js -c -m -o big.min.js +``` + +## Licence + +The MIT Licence. + +See [LICENCE](https://github.com/MikeMcl/bignumber.js/blob/master/LICENCE). diff --git a/node/node_modules/bignumber.js/bignumber.d.ts b/node/node_modules/bignumber.js/bignumber.d.ts new file mode 100644 index 0000000000000000000000000000000000000000..c5a60a8bdb2ab7b14fcd61a796fd63212fe7bab2 --- /dev/null +++ b/node/node_modules/bignumber.js/bignumber.d.ts @@ -0,0 +1,1831 @@ +// Type definitions for bignumber.js >=8.1.0 +// Project: https://github.com/MikeMcl/bignumber.js +// Definitions by: Michael Mclaughlin
+
+
+ BigNumber
+ clone
+
+ config
+
+
+ isBigNumber
+ maximum
+ minimum
+
+ random
+ sum
+
+
+ absoluteValue
+
+ comparedTo
+
+
+
+ decimalPlaces
+ dividedBy
+
+ dividedToIntegerBy
+
+ exponentiatedBy
+
+ integerValue
+ isEqualTo
+ isFinite
+ isGreaterThan
+
+ isGreaterThanOrEqualTo
+ isInteger
+ isLessThan
+
+ isLessThanOrEqualTo
+ isNaN
+ isNegative
+ isPositive
+ isZero
+
+ minus
+ modulo
+
+ multipliedBy
+ negated
+ plus
+
+ precision
+ shiftedBy
+ squareRoot
+
+ toExponential
+
+ toFixed
+
+ toFormat
+
+ toFraction
+ toJSON
+ toNumber
+
+ toPrecision
+ toString
+ valueOf
+
+
+
+
+
+
+
+
+
+
diff --git a/node/node_modules/bignumber.js/package.json b/node/node_modules/bignumber.js/package.json
new file mode 100644
index 0000000000000000000000000000000000000000..e0571a07def93f517b4c5126719478c024403c11
--- /dev/null
+++ b/node/node_modules/bignumber.js/package.json
@@ -0,0 +1,50 @@
+{
+ "name": "bignumber.js",
+ "description": "A library for arbitrary-precision decimal and non-decimal arithmetic",
+ "version": "9.1.2",
+ "keywords": [
+ "arbitrary",
+ "precision",
+ "arithmetic",
+ "big",
+ "number",
+ "decimal",
+ "float",
+ "biginteger",
+ "bigdecimal",
+ "bignumber",
+ "bigint",
+ "bignum"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/MikeMcl/bignumber.js.git"
+ },
+ "main": "bignumber",
+ "module": "bignumber.mjs",
+ "browser": "bignumber.js",
+ "types": "bignumber.d.ts",
+ "exports": {
+ ".": {
+ "types": "./bignumber.d.ts",
+ "require": "./bignumber.js",
+ "import": "./bignumber.mjs",
+ "browser": "./bignumber.js"
+ },
+ "./bignumber.mjs": "./bignumber.mjs",
+ "./bignumber.js": "./bignumber.js",
+ "./package.json": "./package.json"
+ },
+ "author": {
+ "name": "Michael Mclaughlin",
+ "email": "M8ch88l@gmail.com"
+ },
+ "engines": {
+ "node": "*"
+ },
+ "license": "MIT",
+ "scripts": {
+ "test": "node test/test"
+ },
+ "dependencies": {}
+}
diff --git a/node/node_modules/combined-stream/License b/node/node_modules/combined-stream/License
new file mode 100644
index 0000000000000000000000000000000000000000..4804b7ab411f5f72ff74343a88bc503ecc309033
--- /dev/null
+++ b/node/node_modules/combined-stream/License
@@ -0,0 +1,19 @@
+Copyright (c) 2011 Debuggable Limited bignumber.js
+ +A JavaScript library for arbitrary-precision arithmetic.
+ + +API
+ ++ See the README on GitHub for a + quick-start introduction. +
+
+ In all examples below, var and semicolons are not shown, and if a commented-out
+ value is in quotes it means toString has been called on the preceding expression.
+
CONSTRUCTOR
+ + +
+ BigNumberBigNumber(n [, base]) ⇒ BigNumber
+
+
+ n: number|string|BigNumber
+ base: number: integer, 2 to 36 inclusive. (See
+ ALPHABET to extend this range).
+
+ Returns a new instance of a BigNumber object with value n, where n
+ is a numeric value in the specified base, or base 10 if
+ base is omitted or is null or undefined.
+
+ Note that the BigNnumber constructor accepts an n of type number purely
+ as a convenience so that string quotes don't have to be typed when entering literal values,
+ and that it is the toString value of n that is used rather than its
+ underlying binary floating point value converted to decimal.
+
+x = new BigNumber(123.4567) // '123.4567' +// 'new' is optional +y = BigNumber(x) // '123.4567'+
+ If n is a base 10 value it can be in normal or exponential notation.
+ Values in other bases must be in normal notation. Values in any base can have fraction digits,
+ i.e. digits after the decimal point.
+
+new BigNumber(43210) // '43210'
+new BigNumber('4.321e+4') // '43210'
+new BigNumber('-735.0918e-430') // '-7.350918e-428'
+new BigNumber('123412421.234324', 5) // '607236.557696'
+
+ Signed 0, signed Infinity and NaN are supported.
+
+new BigNumber('-Infinity') // '-Infinity'
+new BigNumber(NaN) // 'NaN'
+new BigNumber(-0) // '0'
+new BigNumber('.5') // '0.5'
+new BigNumber('+2') // '2'
+
+ String values in hexadecimal literal form, e.g. '0xff' or '0xFF'
+ (but not '0xfF'), are valid, as are string values with the octal and binary
+ prefixs '0o' and '0b'. String values in octal literal form without
+ the prefix will be interpreted as decimals, e.g. '011' is interpreted as 11, not 9.
+
+new BigNumber(-10110100.1, 2) // '-180.5'
+new BigNumber('-0b10110100.1') // '-180.5'
+new BigNumber('ff.8', 16) // '255.5'
+new BigNumber('0xff.8') // '255.5'
+
+ If a base is specified, n is rounded according to the current
+ DECIMAL_PLACES and
+ ROUNDING_MODE settings. This includes base
+ 10 so don't include a base parameter for decimal values unless
+ this behaviour is wanted.
+
BigNumber.config({ DECIMAL_PLACES: 5 })
+new BigNumber(1.23456789) // '1.23456789'
+new BigNumber(1.23456789, 10) // '1.23457'
+ An error is thrown if base is invalid. See Errors.
+ There is no limit to the number of digits of a value of type string (other than
+ that of JavaScript's maximum array size). See RANGE to set
+ the maximum and minimum possible exponent value of a BigNumber.
+
+new BigNumber('5032485723458348569331745.33434346346912144534543')
+new BigNumber('4.321e10000000')
+ BigNumber NaN is returned if n is invalid
+ (unless BigNumber.DEBUG is true, see below).
+new BigNumber('.1*') // 'NaN'
+new BigNumber('blurgh') // 'NaN'
+new BigNumber(9, 2) // 'NaN'
+
+ To aid in debugging, if BigNumber.DEBUG is true then an error will
+ be thrown on an invalid n. An error will also be thrown if n is of
+ type number and has more than 15 significant digits, as calling
+ toString or valueOf on
+ these numbers may not result in the intended value.
+
+console.log(823456789123456.3) // 823456789123456.2 +new BigNumber(823456789123456.3) // '823456789123456.2' +BigNumber.DEBUG = true +// '[BigNumber Error] Number primitive has more than 15 significant digits' +new BigNumber(823456789123456.3) +// '[BigNumber Error] Not a base 2 number' +new BigNumber(9, 2)+
+ A BigNumber can also be created from an object literal.
+ Use isBigNumber to check that it is well-formed.
+
new BigNumber({ s: 1, e: 2, c: [ 777, 12300000000000 ], _isBigNumber: true }) // '777.123'
+
+
+
+
+ Methods
+The static methods of a BigNumber constructor.
+ + + + +clone
+ .clone([object]) ⇒ BigNumber constructor
+
+ object: object
+ Returns a new independent BigNumber constructor with configuration as described by
+ object (see config), or with the default
+ configuration if object is null or undefined.
+
+ Throws if object is not an object. See Errors.
+
BigNumber.config({ DECIMAL_PLACES: 5 })
+BN = BigNumber.clone({ DECIMAL_PLACES: 9 })
+
+x = new BigNumber(1)
+y = new BN(1)
+
+x.div(3) // 0.33333
+y.div(3) // 0.333333333
+
+// BN = BigNumber.clone({ DECIMAL_PLACES: 9 }) is equivalent to:
+BN = BigNumber.clone()
+BN.config({ DECIMAL_PLACES: 9 })
+
+
+
+ configset([object]) ⇒ object
+
+ object: object: an object that contains some or all of the following
+ properties.
+
Configures the settings for this particular BigNumber constructor.
+ +-
+
DECIMAL_PLACES
+ -
+ number: integer,
0to1e+9inclusive
+ Default value:20+
+ -
+ The maximum number of decimal places of the results of operations involving
+ division, i.e. division, square root and base conversion operations, and power operations
+ with negative exponents.
+
+ -
+
BigNumber.config({ DECIMAL_PLACES: 5 }) +BigNumber.set({ DECIMAL_PLACES: 5 }) // equivalent+
+
+
+
+ ROUNDING_MODE
+ -
+ number: integer,
0to8inclusive
+ Default value:4(ROUND_HALF_UP) +
+ -
+ The rounding mode used in the above operations and the default rounding mode of
+
decimalPlaces, +precision, +toExponential, +toFixed, +toFormatand +toPrecision. +
+ - The modes are available as enumerated properties of the BigNumber constructor. +
-
+
BigNumber.config({ ROUNDING_MODE: 0 }) +BigNumber.set({ ROUNDING_MODE: BigNumber.ROUND_UP }) // equivalent+
+
+
+
+ EXPONENTIAL_AT
+ -
+ number: integer, magnitude
0to1e+9inclusive, or +
+ number[]: [ integer-1e+9to0inclusive, integer +0to1e+9inclusive ]
+ Default value:[-7, 20]+
+ -
+ The exponent value(s) at which
toStringreturns exponential notation. +
+ -
+ If a single number is assigned, the value is the exponent magnitude.
+ If an array of two numbers is assigned then the first number is the negative exponent + value at and beneath which exponential notation is used, and the second number is the + positive exponent value at and above which the same. +
+ -
+ For example, to emulate JavaScript numbers in terms of the exponent values at which they
+ begin to use exponential notation, use
[-7, 20]. +
+ -
+
BigNumber.config({ EXPONENTIAL_AT: 2 }) +new BigNumber(12.3) // '12.3' e is only 1 +new BigNumber(123) // '1.23e+2' +new BigNumber(0.123) // '0.123' e is only -1 +new BigNumber(0.0123) // '1.23e-2' + +BigNumber.config({ EXPONENTIAL_AT: [-7, 20] }) +new BigNumber(123456789) // '123456789' e is only 8 +new BigNumber(0.000000123) // '1.23e-7' + +// Almost never return exponential notation: +BigNumber.config({ EXPONENTIAL_AT: 1e+9 }) + +// Always return exponential notation: +BigNumber.config({ EXPONENTIAL_AT: 0 })+
+ -
+ Regardless of the value of
EXPONENTIAL_AT, thetoFixedmethod + will always return a value in normal notation and thetoExponentialmethod + will always return a value in exponential form. +
+ -
+ Calling
toStringwith a base argument, e.g.toString(10), will + also always return normal notation. +
+
+
+
+ RANGE
+ -
+ number: integer, magnitude
1to1e+9inclusive, or +
+ number[]: [ integer-1e+9to-1inclusive, integer +1to1e+9inclusive ]
+ Default value:[-1e+9, 1e+9]+
+ -
+ The exponent value(s) beyond which overflow to
Infinityand underflow to + zero occurs. +
+ -
+ If a single number is assigned, it is the maximum exponent magnitude: values wth a
+ positive exponent of greater magnitude become
Infinityand those with a + negative exponent of greater magnitude become zero. +- + If an array of two numbers is assigned then the first number is the negative exponent + limit and the second number is the positive exponent limit. +
+- + For example, to emulate JavaScript numbers in terms of the exponent values at which they + become zero and
+Infinity, use[-324, 308]. +- +
+BigNumber.config({ RANGE: 500 }) +BigNumber.config().RANGE // [ -500, 500 ] +new BigNumber('9.999e499') // '9.999e+499' +new BigNumber('1e500') // 'Infinity' +new BigNumber('1e-499') // '1e-499' +new BigNumber('1e-500') // '0' + +BigNumber.config({ RANGE: [-3, 4] }) +new BigNumber(99999) // '99999' e is only 4 +new BigNumber(100000) // 'Infinity' e is 5 +new BigNumber(0.001) // '0.01' e is only -3 +new BigNumber(0.0001) // '0' e is -4+- + The largest possible magnitude of a finite BigNumber is +
+ + + +9.999...e+1000000000.
+ The smallest possible magnitude of a non-zero BigNumber is1e-1000000000. + CRYPTO
+ -
+ boolean:
trueorfalse.
+ Default value:false+
+ - + The value that determines whether cryptographically-secure pseudo-random number + generation is used. + +
-
+ If
CRYPTOis set totruethen the +randommethod will generate random digits using +crypto.getRandomValuesin browsers that support it, or +crypto.randomBytesif using Node.js. +
+ -
+ If neither function is supported by the host environment then attempting to set
+
CRYPTOtotruewill fail and an exception will be thrown. +
+ -
+ If
CRYPTOisfalsethen the source of randomness used will be +Math.random(which is assumed to generate at least30bits of + randomness). +
+ - See
random.
+ -
+
+// Node.js +const crypto = require('crypto'); // CommonJS +import * as crypto from 'crypto'; // ES module + +global.crypto = crypto; + +BigNumber.config({ CRYPTO: true }) +BigNumber.config().CRYPTO // true +BigNumber.random() // 0.54340758610486147524+
+
+
+
+ MODULO_MODE
+ -
+ number: integer,
0to9inclusive
+ Default value:1(ROUND_DOWN) +
+ - The modulo mode used when calculating the modulus:
a mod n.
+ -
+ The quotient,
q = a / n, is calculated according to the +ROUNDING_MODEthat corresponds to the chosen +MODULO_MODE. +
+ - The remainder,
r, is calculated as:r = a - n * q.
+ - + The modes that are most commonly used for the modulus/remainder operation are shown in + the following table. Although the other rounding modes can be used, they may not give + useful results. + +
-
+
+
+Property Value Description + +ROUND_UP 0 ++ The remainder is positive if the dividend is negative, otherwise it is negative. + ++ +ROUND_DOWN 1 ++ The remainder has the same sign as the dividend. +
+ This uses 'truncating division' and matches the behaviour of JavaScript's + remainder operator%. ++ +ROUND_FLOOR 3 ++ The remainder has the same sign as the divisor. +
+ This matches Python's%operator. ++ +ROUND_HALF_EVEN 6 +The IEEE 754 remainder function. ++ +EUCLID 9 ++ The remainder is always positive. Euclidian division: +
+q = sign(n) * floor(a / abs(n))+
+ - + The rounding/modulo modes are available as enumerated properties of the BigNumber + constructor. + +
- See
modulo.
+ -
+
BigNumber.config({ MODULO_MODE: BigNumber.EUCLID }) +BigNumber.config({ MODULO_MODE: 9 }) // equivalent+
+
+
+
+ POW_PRECISION
+ -
+ number: integer,
0to1e+9inclusive.
+ Default value:0+
+ - + The maximum precision, i.e. number of significant digits, of the result of the power + operation (unless a modulus is specified). + +
- If set to
0, the number of significant digits will not be limited.
+ - See
exponentiatedBy.
+ BigNumber.config({ POW_PRECISION: 100 })
+
+
+
+ FORMAT
+ - object +
-
+ The
FORMATobject configures the format of the string returned by the +toFormatmethod. +
+ -
+ The example below shows the properties of the
FORMATobject that are + recognised, and their default values. +
+ -
+ Unlike the other configuration properties, the values of the properties of the
+
FORMATobject will not be checked for validity. The existing +FORMATobject will simply be replaced by the object that is passed in. + The object can include any number of the properties shown below. +
+ - See
toFormatfor examples of usage.
+ -
+
+BigNumber.config({ + FORMAT: { + // string to prepend + prefix: '', + // decimal separator + decimalSeparator: '.', + // grouping separator of the integer part + groupSeparator: ',', + // primary grouping size of the integer part + groupSize: 3, + // secondary grouping size of the integer part + secondaryGroupSize: 0, + // grouping separator of the fraction part + fractionGroupSeparator: ' ', + // grouping size of the fraction part + fractionGroupSize: 0, + // string to append + suffix: '' + } +});+
+
+
+
+ ALPHABET
+ -
+ string
+ Default value:'0123456789abcdefghijklmnopqrstuvwxyz'+
+ -
+ The alphabet used for base conversion. The length of the alphabet corresponds to the
+ maximum value of the base argument that can be passed to the
+
BigNumberconstructor or +toString. +
+ -
+ There is no maximum length for the alphabet, but it must be at least 2 characters long, and
+ it must not contain whitespace or a repeated character, or the sign indicators
+
'+'and'-', or the decimal separator'.'. +
+ -
+
// duodecimal (base 12) +BigNumber.config({ ALPHABET: '0123456789TE' }) +x = new BigNumber('T', 12) +x.toString() // '10' +x.toString(12) // 'T'+
+
+
+
+
+
Returns an object with the above properties and their current values.
+
+ Throws if object is not an object, or if an invalid value is assigned to
+ one or more of the above properties. See Errors.
+
+BigNumber.config({
+ DECIMAL_PLACES: 40,
+ ROUNDING_MODE: BigNumber.ROUND_HALF_CEIL,
+ EXPONENTIAL_AT: [-10, 20],
+ RANGE: [-500, 500],
+ CRYPTO: true,
+ MODULO_MODE: BigNumber.ROUND_FLOOR,
+ POW_PRECISION: 80,
+ FORMAT: {
+ groupSize: 3,
+ groupSeparator: ' ',
+ decimalSeparator: ','
+ },
+ ALPHABET: '0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ$_'
+});
+
+obj = BigNumber.config();
+obj.DECIMAL_PLACES // 40
+obj.RANGE // [-500, 500]
+
+
+
+
+ isBigNumber.isBigNumber(value) ⇒ boolean
+
+ value: any
+ Returns true if value is a BigNumber instance, otherwise returns
+ false.
+
x = 42 +y = new BigNumber(x) + +BigNumber.isBigNumber(x) // false +y instanceof BigNumber // true +BigNumber.isBigNumber(y) // true + +BN = BigNumber.clone(); +z = new BN(x) +z instanceof BigNumber // false +BigNumber.isBigNumber(z) // true+
+ If value is a BigNumber instance and BigNumber.DEBUG is true,
+ then this method will also check if value is well-formed, and throw if it is not.
+ See Errors.
+
+ The check can be useful if creating a BigNumber from an object literal. + See BigNumber. +
++x = new BigNumber(10) + +// Change x.c to an illegitimate value. +x.c = NaN + +BigNumber.DEBUG = false + +// No error. +BigNumber.isBigNumber(x) // true + +BigNumber.DEBUG = true + +// Error. +BigNumber.isBigNumber(x) // '[BigNumber Error] Invalid BigNumber'+ + + +
maximum.max(n...) ⇒ BigNumber
+
+ n: number|string|BigNumber
+ See BigNumber for further parameter details.
+
+ Returns a BigNumber whose value is the maximum of the arguments. +
+The return value is always exact and unrounded.
+x = new BigNumber('3257869345.0378653')
+BigNumber.maximum(4e9, x, '123456789.9') // '4000000000'
+
+arr = [12, '13', new BigNumber(14)]
+BigNumber.max.apply(null, arr) // '14'
+
+
+
+ minimum.min(n...) ⇒ BigNumber
+
+ n: number|string|BigNumber
+ See BigNumber for further parameter details.
+
+ Returns a BigNumber whose value is the minimum of the arguments. +
+The return value is always exact and unrounded.
+x = new BigNumber('3257869345.0378653')
+BigNumber.minimum(4e9, x, '123456789.9') // '123456789.9'
+
+arr = [2, new BigNumber(-14), '-15.9999', -12]
+BigNumber.min.apply(null, arr) // '-15.9999'
+
+
+
+
+ random.random([dp]) ⇒ BigNumber
+
+ dp: number: integer, 0 to 1e+9 inclusive
+ Returns a new BigNumber with a pseudo-random value equal to or greater than 0 and
+ less than 1.
+
+ The return value will have dp decimal places (or less if trailing zeros are
+ produced).
+ If dp is omitted then the number of decimal places will default to the current
+ DECIMAL_PLACES setting.
+
+ Depending on the value of this BigNumber constructor's
+ CRYPTO setting and the support for the
+ crypto object in the host environment, the random digits of the return value are
+ generated by either Math.random (fastest), crypto.getRandomValues
+ (Web Cryptography API in recent browsers) or crypto.randomBytes (Node.js).
+
+ To be able to set CRYPTO to true when using
+ Node.js, the crypto object must be available globally:
+
// Node.js
+const crypto = require('crypto'); // CommonJS
+import * as crypto from 'crypto'; // ES module
+global.crypto = crypto;
+
+ If CRYPTO is true, i.e. one of the
+ crypto methods is to be used, the value of a returned BigNumber should be
+ cryptographically-secure and statistically indistinguishable from a random value.
+
+ Throws if dp is invalid. See Errors.
+
BigNumber.config({ DECIMAL_PLACES: 10 })
+BigNumber.random() // '0.4117936847'
+BigNumber.random(20) // '0.78193327636914089009'
+
+
+
+ sum.sum(n...) ⇒ BigNumber
+
+ n: number|string|BigNumber
+ See BigNumber for further parameter details.
+
Returns a BigNumber whose value is the sum of the arguments.
+The return value is always exact and unrounded.
+x = new BigNumber('3257869345.0378653')
+BigNumber.sum(4e9, x, '123456789.9') // '7381326134.9378653'
+
+arr = [2, new BigNumber(14), '15.9999', 12]
+BigNumber.sum.apply(null, arr) // '43.9999'
+
+
+
+ Properties
+
+ The library's enumerated rounding modes are stored as properties of the constructor.
+ (They are not referenced internally by the library itself.)
+
+ Rounding modes 0 to 6 (inclusive) are the same as those of Java's
+ BigDecimal class.
+
| Property | +Value | +Description | +
|---|---|---|
| ROUND_UP | +0 | +Rounds away from zero | +
| ROUND_DOWN | +1 | +Rounds towards zero | +
| ROUND_CEIL | +2 | +Rounds towards Infinity |
+
| ROUND_FLOOR | +3 | +Rounds towards -Infinity |
+
| ROUND_HALF_UP | +4 | +
+ Rounds towards nearest neighbour. + If equidistant, rounds away from zero + |
+
| ROUND_HALF_DOWN | +5 | +
+ Rounds towards nearest neighbour. + If equidistant, rounds towards zero + |
+
| ROUND_HALF_EVEN | +6 | +
+ Rounds towards nearest neighbour. + If equidistant, rounds towards even neighbour + |
+
| ROUND_HALF_CEIL | +7 | +
+ Rounds towards nearest neighbour. + If equidistant, rounds towards Infinity
+ |
+
| ROUND_HALF_FLOOR | +8 | +
+ Rounds towards nearest neighbour. + If equidistant, rounds towards -Infinity
+ |
+
+BigNumber.config({ ROUNDING_MODE: BigNumber.ROUND_CEIL })
+BigNumber.config({ ROUNDING_MODE: 2 }) // equivalent
+
+ DEBUG
+undefined|false|true
+
+ If BigNumber.DEBUG is set true then an error will be thrown
+ if this BigNumber constructor receives an invalid value, such as
+ a value of type number with more than 15 significant digits.
+ See BigNumber.
+
+ An error will also be thrown if the isBigNumber
+ method receives a BigNumber that is not well-formed.
+ See isBigNumber.
+
BigNumber.DEBUG = true+ + +
INSTANCE
+ + +Methods
+The methods inherited by a BigNumber instance from its constructor's prototype object.
+A BigNumber is immutable in the sense that it is not changed by its methods.
+
+ The treatment of ±0, ±Infinity and NaN is
+ consistent with how JavaScript treats these values.
+
Many method names have a shorter alias.
+ + + +absoluteValue.abs() ⇒ BigNumber
+ + Returns a BigNumber whose value is the absolute value, i.e. the magnitude, of the value of + this BigNumber. +
+The return value is always exact and unrounded.
++x = new BigNumber(-0.8) +y = x.absoluteValue() // '0.8' +z = y.abs() // '0.8'+ + + +
+ comparedTo.comparedTo(n [, base]) ⇒ number
+
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
| Returns | |
|---|---|
1 |
+ If the value of this BigNumber is greater than the value of n |
+
-1 |
+ If the value of this BigNumber is less than the value of n |
+
0 |
+ If this BigNumber and n have the same value |
+
null |
+ If the value of either this BigNumber or n is NaN |
+
+x = new BigNumber(Infinity)
+y = new BigNumber(5)
+x.comparedTo(y) // 1
+x.comparedTo(x.minus(1)) // 0
+y.comparedTo(NaN) // null
+y.comparedTo('110', 2) // -1
+
+
+
+
+ decimalPlaces.dp([dp [, rm]]) ⇒ BigNumber|number
+
+
+ dp: number: integer, 0 to 1e+9 inclusive
+ rm: number: integer, 0 to 8 inclusive
+
+ If dp is a number, returns a BigNumber whose value is the value of this BigNumber
+ rounded by rounding mode rm to a maximum of dp decimal places.
+
+ If dp is omitted, or is null or undefined, the return
+ value is the number of decimal places of the value of this BigNumber, or null if
+ the value of this BigNumber is ±Infinity or NaN.
+
+ If rm is omitted, or is null or undefined,
+ ROUNDING_MODE is used.
+
+ Throws if dp or rm is invalid. See Errors.
+
+x = new BigNumber(1234.56)
+x.decimalPlaces(1) // '1234.6'
+x.dp() // 2
+x.decimalPlaces(2) // '1234.56'
+x.dp(10) // '1234.56'
+x.decimalPlaces(0, 1) // '1234'
+x.dp(0, 6) // '1235'
+x.decimalPlaces(1, 1) // '1234.5'
+x.dp(1, BigNumber.ROUND_HALF_EVEN) // '1234.6'
+x // '1234.56'
+y = new BigNumber('9.9e-101')
+y.dp() // 102
+
+
+
+ dividedBy.div(n [, base]) ⇒ BigNumber
+
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+ Returns a BigNumber whose value is the value of this BigNumber divided by
+ n, rounded according to the current
+ DECIMAL_PLACES and
+ ROUNDING_MODE settings.
+
+x = new BigNumber(355) +y = new BigNumber(113) +x.dividedBy(y) // '3.14159292035398230088' +x.div(5) // '71' +x.div(47, 16) // '5'+ + + +
+ dividedToIntegerBy.idiv(n [, base]) ⇒
+ BigNumber
+
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+ Returns a BigNumber whose value is the integer part of dividing the value of this BigNumber by
+ n.
+
+x = new BigNumber(5)
+y = new BigNumber(3)
+x.dividedToIntegerBy(y) // '1'
+x.idiv(0.7) // '7'
+x.idiv('0.f', 16) // '5'
+
+
+
+
+ exponentiatedBy.pow(n [, m]) ⇒ BigNumber
+
+
+ n: number|string|BigNumber: integer
+ m: number|string|BigNumber
+
+ Returns a BigNumber whose value is the value of this BigNumber exponentiated by
+ n, i.e. raised to the power n, and optionally modulo a modulus
+ m.
+
+ Throws if n is not an integer. See Errors.
+
+ If n is negative the result is rounded according to the current
+ DECIMAL_PLACES and
+ ROUNDING_MODE settings.
+
+ As the number of digits of the result of the power operation can grow so large so quickly,
+ e.g. 123.45610000 has over 50000 digits, the number of significant
+ digits calculated is limited to the value of the
+ POW_PRECISION setting (unless a modulus
+ m is specified).
+
+ By default POW_PRECISION is set to 0.
+ This means that an unlimited number of significant digits will be calculated, and that the
+ method's performance will decrease dramatically for larger exponents.
+
+ If m is specified and the value of m, n and this
+ BigNumber are integers, and n is positive, then a fast modular exponentiation
+ algorithm is used, otherwise the operation will be performed as
+ x.exponentiatedBy(n).modulo(m) with a
+ POW_PRECISION of 0.
+
+Math.pow(0.7, 2) // 0.48999999999999994 +x = new BigNumber(0.7) +x.exponentiatedBy(2) // '0.49' +BigNumber(3).pow(-2) // '0.11111111111111111111'+ + + +
+ integerValue.integerValue([rm]) ⇒ BigNumber
+
+
+ rm: number: integer, 0 to 8 inclusive
+
+ Returns a BigNumber whose value is the value of this BigNumber rounded to an integer using
+ rounding mode rm.
+
+ If rm is omitted, or is null or undefined,
+ ROUNDING_MODE is used.
+
+ Throws if rm is invalid. See Errors.
+
+x = new BigNumber(123.456) +x.integerValue() // '123' +x.integerValue(BigNumber.ROUND_CEIL) // '124' +y = new BigNumber(-12.7) +y.integerValue() // '-13' +y.integerValue(BigNumber.ROUND_DOWN) // '-12'+
+ The following is an example of how to add a prototype method that emulates JavaScript's
+ Math.round function. Math.ceil, Math.floor and
+ Math.trunc can be emulated in the same way with
+ BigNumber.ROUND_CEIL, BigNumber.ROUND_FLOOR and
+ BigNumber.ROUND_DOWN respectively.
+
+BigNumber.prototype.round = function () {
+ return this.integerValue(BigNumber.ROUND_HALF_CEIL);
+};
+x.round() // '123'
+
+
+
+ isEqualTo.eq(n [, base]) ⇒ boolean
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+ Returns true if the value of this BigNumber is equal to the value of
+ n, otherwise returns false.
+ As with JavaScript, NaN does not equal NaN.
+
Note: This method uses the comparedTo method internally.
+0 === 1e-324 // true
+x = new BigNumber(0)
+x.isEqualTo('1e-324') // false
+BigNumber(-0).eq(x) // true ( -0 === 0 )
+BigNumber(255).eq('ff', 16) // true
+
+y = new BigNumber(NaN)
+y.isEqualTo(NaN) // false
+
+
+
+ isFinite.isFinite() ⇒ boolean
+
+ Returns true if the value of this BigNumber is a finite number, otherwise
+ returns false.
+
+ The only possible non-finite values of a BigNumber are NaN, Infinity
+ and -Infinity.
+
+x = new BigNumber(1) +x.isFinite() // true +y = new BigNumber(Infinity) +y.isFinite() // false+
+ Note: The native method isFinite() can be used if
+ n <= Number.MAX_VALUE.
+
isGreaterThan.gt(n [, base]) ⇒ boolean
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+ Returns true if the value of this BigNumber is greater than the value of
+ n, otherwise returns false.
+
Note: This method uses the comparedTo method internally.
+0.1 > (0.3 - 0.2) // true +x = new BigNumber(0.1) +x.isGreaterThan(BigNumber(0.3).minus(0.2)) // false +BigNumber(0).gt(x) // false +BigNumber(11, 3).gt(11.1, 2) // true+ + + +
+ isGreaterThanOrEqualTo.gte(n [, base]) ⇒ boolean
+
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+ Returns true if the value of this BigNumber is greater than or equal to the value
+ of n, otherwise returns false.
+
Note: This method uses the comparedTo method internally.
+(0.3 - 0.2) >= 0.1 // false
+x = new BigNumber(0.3).minus(0.2)
+x.isGreaterThanOrEqualTo(0.1) // true
+BigNumber(1).gte(x) // true
+BigNumber(10, 18).gte('i', 36) // true
+
+
+
+ isInteger.isInteger() ⇒ boolean
+
+ Returns true if the value of this BigNumber is an integer, otherwise returns
+ false.
+
+x = new BigNumber(1) +x.isInteger() // true +y = new BigNumber(123.456) +y.isInteger() // false+ + + +
isLessThan.lt(n [, base]) ⇒ boolean
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+ Returns true if the value of this BigNumber is less than the value of
+ n, otherwise returns false.
+
Note: This method uses the comparedTo method internally.
+(0.3 - 0.2) < 0.1 // true +x = new BigNumber(0.3).minus(0.2) +x.isLessThan(0.1) // false +BigNumber(0).lt(x) // true +BigNumber(11.1, 2).lt(11, 3) // true+ + + +
+ isLessThanOrEqualTo.lte(n [, base]) ⇒ boolean
+
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+ Returns true if the value of this BigNumber is less than or equal to the value of
+ n, otherwise returns false.
+
Note: This method uses the comparedTo method internally.
+0.1 <= (0.3 - 0.2) // false
+x = new BigNumber(0.1)
+x.isLessThanOrEqualTo(BigNumber(0.3).minus(0.2)) // true
+BigNumber(-1).lte(x) // true
+BigNumber(10, 18).lte('i', 36) // true
+
+
+
+ isNaN.isNaN() ⇒ boolean
+
+ Returns true if the value of this BigNumber is NaN, otherwise
+ returns false.
+
+x = new BigNumber(NaN)
+x.isNaN() // true
+y = new BigNumber('Infinity')
+y.isNaN() // false
+ Note: The native method isNaN() can also be used.
isNegative.isNegative() ⇒ boolean
+
+ Returns true if the sign of this BigNumber is negative, otherwise returns
+ false.
+
+x = new BigNumber(-0) +x.isNegative() // true +y = new BigNumber(2) +y.isNegative() // false+
Note: n < 0 can be used if n <= -Number.MIN_VALUE.
isPositive.isPositive() ⇒ boolean
+
+ Returns true if the sign of this BigNumber is positive, otherwise returns
+ false.
+
+x = new BigNumber(-0) +x.isPositive() // false +y = new BigNumber(2) +y.isPositive() // true+ + + +
isZero.isZero() ⇒ boolean
+
+ Returns true if the value of this BigNumber is zero or minus zero, otherwise
+ returns false.
+
+x = new BigNumber(-0) +x.isZero() && x.isNegative() // true +y = new BigNumber(Infinity) +y.isZero() // false+
Note: n == 0 can be used if n >= Number.MIN_VALUE.
+ minus.minus(n [, base]) ⇒ BigNumber
+
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
Returns a BigNumber whose value is the value of this BigNumber minus n.
The return value is always exact and unrounded.
++0.3 - 0.1 // 0.19999999999999998 +x = new BigNumber(0.3) +x.minus(0.1) // '0.2' +x.minus(0.6, 20) // '0'+ + + +
modulo.mod(n [, base]) ⇒ BigNumber
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+ Returns a BigNumber whose value is the value of this BigNumber modulo n, i.e.
+ the integer remainder of dividing this BigNumber by n.
+
+ The value returned, and in particular its sign, is dependent on the value of the
+ MODULO_MODE setting of this BigNumber constructor.
+ If it is 1 (default value), the result will have the same sign as this BigNumber,
+ and it will match that of Javascript's % operator (within the limits of double
+ precision) and BigDecimal's remainder method.
+
The return value is always exact and unrounded.
+
+ See MODULO_MODE for a description of the other
+ modulo modes.
+
+1 % 0.9 // 0.09999999999999998
+x = new BigNumber(1)
+x.modulo(0.9) // '0.1'
+y = new BigNumber(33)
+y.mod('a', 33) // '3'
+
+
+
+
+ multipliedBy.times(n [, base]) ⇒ BigNumber
+
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
+ Returns a BigNumber whose value is the value of this BigNumber multiplied by n.
+
The return value is always exact and unrounded.
+
+0.6 * 3 // 1.7999999999999998
+x = new BigNumber(0.6)
+y = x.multipliedBy(3) // '1.8'
+BigNumber('7e+500').times(y) // '1.26e+501'
+x.multipliedBy('-a', 16) // '-6'
+
+
+
+ negated.negated() ⇒ BigNumber
+
+ Returns a BigNumber whose value is the value of this BigNumber negated, i.e. multiplied by
+ -1.
+
+x = new BigNumber(1.8) +x.negated() // '-1.8' +y = new BigNumber(-1.3) +y.negated() // '1.3'+ + + +
plus.plus(n [, base]) ⇒ BigNumber
+
+ n: number|string|BigNumber
+ base: number
+ See BigNumber for further parameter details.
+
Returns a BigNumber whose value is the value of this BigNumber plus n.
The return value is always exact and unrounded.
+
+0.1 + 0.2 // 0.30000000000000004
+x = new BigNumber(0.1)
+y = x.plus(0.2) // '0.3'
+BigNumber(0.7).plus(x).plus(y) // '1.1'
+x.plus('0.1', 8) // '0.225'
+
+
+
+
+ precision.sd([d [, rm]]) ⇒ BigNumber|number
+
+
+ d: number|boolean: integer, 1 to 1e+9
+ inclusive, or true or false
+ rm: number: integer, 0 to 8 inclusive.
+
+ If d is a number, returns a BigNumber whose value is the value of this BigNumber
+ rounded to a precision of d significant digits using rounding mode
+ rm.
+
+ If d is omitted or is null or undefined, the return
+ value is the number of significant digits of the value of this BigNumber, or null
+ if the value of this BigNumber is ±Infinity or NaN.
+
+ If d is true then any trailing zeros of the integer
+ part of a number are counted as significant digits, otherwise they are not.
+
+ If rm is omitted or is null or undefined,
+ ROUNDING_MODE will be used.
+
+ Throws if d or rm is invalid. See Errors.
+
+x = new BigNumber(9876.54321) +x.precision(6) // '9876.54' +x.sd() // 9 +x.precision(6, BigNumber.ROUND_UP) // '9876.55' +x.sd(2) // '9900' +x.precision(2, 1) // '9800' +x // '9876.54321' +y = new BigNumber(987000) +y.precision() // 3 +y.sd(true) // 6+ + + +
shiftedBy.shiftedBy(n) ⇒ BigNumber
+
+ n: number: integer,
+ -9007199254740991 to 9007199254740991 inclusive
+
+ Returns a BigNumber whose value is the value of this BigNumber shifted by n
+ places.
+
+ The shift is of the decimal point, i.e. of powers of ten, and is to the left if n
+ is negative or to the right if n is positive.
+
The return value is always exact and unrounded.
+
+ Throws if n is invalid. See Errors.
+
+x = new BigNumber(1.23) +x.shiftedBy(3) // '1230' +x.shiftedBy(-3) // '0.00123'+ + + +
squareRoot.sqrt() ⇒ BigNumber
+
+ Returns a BigNumber whose value is the square root of the value of this BigNumber,
+ rounded according to the current
+ DECIMAL_PLACES and
+ ROUNDING_MODE settings.
+
+ The return value will be correctly rounded, i.e. rounded as if the result was first calculated + to an infinite number of correct digits before rounding. +
++x = new BigNumber(16) +x.squareRoot() // '4' +y = new BigNumber(3) +y.sqrt() // '1.73205080756887729353'+ + + +
+ toExponential.toExponential([dp [, rm]]) ⇒ string
+
+
+ dp: number: integer, 0 to 1e+9 inclusive
+ rm: number: integer, 0 to 8 inclusive
+
+ Returns a string representing the value of this BigNumber in exponential notation rounded
+ using rounding mode rm to dp decimal places, i.e with one digit
+ before the decimal point and dp digits after it.
+
+ If the value of this BigNumber in exponential notation has fewer than dp fraction
+ digits, the return value will be appended with zeros accordingly.
+
+ If dp is omitted, or is null or undefined, the number
+ of digits after the decimal point defaults to the minimum number of digits necessary to
+ represent the value exactly.
+ If rm is omitted or is null or undefined,
+ ROUNDING_MODE is used.
+
+ Throws if dp or rm is invalid. See Errors.
+
+x = 45.6 +y = new BigNumber(x) +x.toExponential() // '4.56e+1' +y.toExponential() // '4.56e+1' +x.toExponential(0) // '5e+1' +y.toExponential(0) // '5e+1' +x.toExponential(1) // '4.6e+1' +y.toExponential(1) // '4.6e+1' +y.toExponential(1, 1) // '4.5e+1' (ROUND_DOWN) +x.toExponential(3) // '4.560e+1' +y.toExponential(3) // '4.560e+1'+ + + +
+ toFixed.toFixed([dp [, rm]]) ⇒ string
+
+
+ dp: number: integer, 0 to 1e+9 inclusive
+ rm: number: integer, 0 to 8 inclusive
+
+ Returns a string representing the value of this BigNumber in normal (fixed-point) notation
+ rounded to dp decimal places using rounding mode rm.
+
+ If the value of this BigNumber in normal notation has fewer than dp fraction
+ digits, the return value will be appended with zeros accordingly.
+
+ Unlike Number.prototype.toFixed, which returns exponential notation if a number
+ is greater or equal to 1021, this method will always return normal
+ notation.
+
+ If dp is omitted or is null or undefined, the return
+ value will be unrounded and in normal notation. This is also unlike
+ Number.prototype.toFixed, which returns the value to zero decimal places.
+ It is useful when fixed-point notation is required and the current
+ EXPONENTIAL_AT setting causes
+ toString to return exponential notation.
+ If rm is omitted or is null or undefined,
+ ROUNDING_MODE is used.
+
+ Throws if dp or rm is invalid. See Errors.
+
+x = 3.456 +y = new BigNumber(x) +x.toFixed() // '3' +y.toFixed() // '3.456' +y.toFixed(0) // '3' +x.toFixed(2) // '3.46' +y.toFixed(2) // '3.46' +y.toFixed(2, 1) // '3.45' (ROUND_DOWN) +x.toFixed(5) // '3.45600' +y.toFixed(5) // '3.45600'+ + + +
+ toFormat.toFormat([dp [, rm[, format]]]) ⇒ string
+
+
+ dp: number: integer, 0 to 1e+9 inclusive
+ rm: number: integer, 0 to 8 inclusive
+ format: object: see FORMAT
+
+
+ Returns a string representing the value of this BigNumber in normal (fixed-point) notation
+ rounded to dp decimal places using rounding mode rm, and formatted
+ according to the properties of the format object.
+
+ See FORMAT and the examples below for the properties of the
+ format object, their types, and their usage. A formatting object may contain
+ some or all of the recognised properties.
+
+ If dp is omitted or is null or undefined, then the
+ return value is not rounded to a fixed number of decimal places.
+ If rm is omitted or is null or undefined,
+ ROUNDING_MODE is used.
+ If format is omitted or is null or undefined, the
+ FORMAT object is used.
+
+ Throws if dp, rm or format is invalid. See
+ Errors.
+
+fmt = {
+ prefix: '',
+ decimalSeparator: '.',
+ groupSeparator: ',',
+ groupSize: 3,
+ secondaryGroupSize: 0,
+ fractionGroupSeparator: ' ',
+ fractionGroupSize: 0,
+ suffix: ''
+}
+
+x = new BigNumber('123456789.123456789')
+
+// Set the global formatting options
+BigNumber.config({ FORMAT: fmt })
+
+x.toFormat() // '123,456,789.123456789'
+x.toFormat(3) // '123,456,789.123'
+
+// If a reference to the object assigned to FORMAT has been retained,
+// the format properties can be changed directly
+fmt.groupSeparator = ' '
+fmt.fractionGroupSize = 5
+x.toFormat() // '123 456 789.12345 6789'
+
+// Alternatively, pass the formatting options as an argument
+fmt = {
+ prefix: '=> ',
+ decimalSeparator: ',',
+ groupSeparator: '.',
+ groupSize: 3,
+ secondaryGroupSize: 2
+}
+
+x.toFormat() // '123 456 789.12345 6789'
+x.toFormat(fmt) // '=> 12.34.56.789,123456789'
+x.toFormat(2, fmt) // '=> 12.34.56.789,12'
+x.toFormat(3, BigNumber.ROUND_UP, fmt) // '=> 12.34.56.789,124'
+
+
+
+
+ toFraction.toFraction([maximum_denominator])
+ ⇒ [BigNumber, BigNumber]
+
+
+ maximum_denominator:
+ number|string|BigNumber: integer >= 1 and <=
+ Infinity
+
+ Returns an array of two BigNumbers representing the value of this BigNumber as a simple
+ fraction with an integer numerator and an integer denominator. The denominator will be a
+ positive non-zero value less than or equal to maximum_denominator.
+
+ If a maximum_denominator is not specified, or is null or
+ undefined, the denominator will be the lowest value necessary to represent the
+ number exactly.
+
+ Throws if maximum_denominator is invalid. See Errors.
+
+x = new BigNumber(1.75)
+x.toFraction() // '7, 4'
+
+pi = new BigNumber('3.14159265358')
+pi.toFraction() // '157079632679,50000000000'
+pi.toFraction(100000) // '312689, 99532'
+pi.toFraction(10000) // '355, 113'
+pi.toFraction(100) // '311, 99'
+pi.toFraction(10) // '22, 7'
+pi.toFraction(1) // '3, 1'
+
+
+
+ toJSON.toJSON() ⇒ string
+ As valueOf.
+x = new BigNumber('177.7e+457')
+y = new BigNumber(235.4325)
+z = new BigNumber('0.0098074')
+
+// Serialize an array of three BigNumbers
+str = JSON.stringify( [x, y, z] )
+// "["1.777e+459","235.4325","0.0098074"]"
+
+// Return an array of three BigNumbers
+JSON.parse(str, function (key, val) {
+ return key === '' ? val : new BigNumber(val)
+})
+
+
+
+ toNumber.toNumber() ⇒ number
+ Returns the value of this BigNumber as a JavaScript number primitive.
++ This method is identical to using type coercion with the unary plus operator. +
+
+x = new BigNumber(456.789)
+x.toNumber() // 456.789
++x // 456.789
+
+y = new BigNumber('45987349857634085409857349856430985')
+y.toNumber() // 4.598734985763409e+34
+
+z = new BigNumber(-0)
+1 / z.toNumber() // -Infinity
+1 / +z // -Infinity
+
+
+
+
+ toPrecision.toPrecision([sd [, rm]]) ⇒ string
+
+
+ sd: number: integer, 1 to 1e+9 inclusive
+ rm: number: integer, 0 to 8 inclusive
+
+ Returns a string representing the value of this BigNumber rounded to sd
+ significant digits using rounding mode rm.
+
+ If sd is less than the number of digits necessary to represent the integer part
+ of the value in normal (fixed-point) notation, then exponential notation is used.
+
+ If sd is omitted, or is null or undefined, then the
+ return value is the same as n.toString().
+ If rm is omitted or is null or undefined,
+ ROUNDING_MODE is used.
+
+ Throws if sd or rm is invalid. See Errors.
+
+x = 45.6 +y = new BigNumber(x) +x.toPrecision() // '45.6' +y.toPrecision() // '45.6' +x.toPrecision(1) // '5e+1' +y.toPrecision(1) // '5e+1' +y.toPrecision(2, 0) // '4.6e+1' (ROUND_UP) +y.toPrecision(2, 1) // '4.5e+1' (ROUND_DOWN) +x.toPrecision(5) // '45.600' +y.toPrecision(5) // '45.600'+ + + +
toString.toString([base]) ⇒ string
+
+ base: number: integer, 2 to ALPHABET.length
+ inclusive (see ALPHABET).
+
+ Returns a string representing the value of this BigNumber in the specified base, or base
+ 10 if base is omitted or is null or
+ undefined.
+
+ For bases above 10, and using the default base conversion alphabet
+ (see ALPHABET), values from 10 to
+ 35 are represented by a-z
+ (as with Number.prototype.toString).
+
+ If a base is specified the value is rounded according to the current
+ DECIMAL_PLACES
+ and ROUNDING_MODE settings.
+
+ If a base is not specified, and this BigNumber has a positive
+ exponent that is equal to or greater than the positive component of the
+ current EXPONENTIAL_AT setting,
+ or a negative exponent equal to or less than the negative component of the
+ setting, then exponential notation is returned.
+
If base is null or undefined it is ignored.
+ Throws if base is invalid. See Errors.
+
+x = new BigNumber(750000)
+x.toString() // '750000'
+BigNumber.config({ EXPONENTIAL_AT: 5 })
+x.toString() // '7.5e+5'
+
+y = new BigNumber(362.875)
+y.toString(2) // '101101010.111'
+y.toString(9) // '442.77777777777777777778'
+y.toString(32) // 'ba.s'
+
+BigNumber.config({ DECIMAL_PLACES: 4 });
+z = new BigNumber('1.23456789')
+z.toString() // '1.23456789'
+z.toString(10) // '1.2346'
+
+
+
+ valueOf.valueOf() ⇒ string
+
+ As toString, but does not accept a base argument and includes
+ the minus sign for negative zero.
+
+x = new BigNumber('-0')
+x.toString() // '0'
+x.valueOf() // '-0'
+y = new BigNumber('1.777e+457')
+y.valueOf() // '1.777e+457'
+
+
+
+ Properties
+The properties of a BigNumber instance:
+| Property | +Description | +Type | +Value | +
|---|---|---|---|
| c | +coefficient* | +number[] |
+ Array of base 1e14 numbers |
+
| e | +exponent | +number | +Integer, -1000000000 to 1000000000 inclusive |
+
| s | +sign | +number | +-1 or 1 |
+
*significand
+
+ The value of any of the c, e and s properties may also
+ be null.
+
+ The above properties are best considered to be read-only. In early versions of this library it + was okay to change the exponent of a BigNumber by writing to its exponent property directly, + but this is no longer reliable as the value of the first element of the coefficient array is + now dependent on the exponent. +
++ Note that, as with JavaScript numbers, the original exponent and fractional trailing zeros are + not necessarily preserved. +
+x = new BigNumber(0.123) // '0.123'
+x.toExponential() // '1.23e-1'
+x.c // '1,2,3'
+x.e // -1
+x.s // 1
+
+y = new Number(-123.4567000e+2) // '-12345.67'
+y.toExponential() // '-1.234567e+4'
+z = new BigNumber('-123.4567000e+2') // '-12345.67'
+z.toExponential() // '-1.234567e+4'
+z.c // '1,2,3,4,5,6,7'
+z.e // 4
+z.s // -1
+
+
+
+ Zero, NaN and Infinity
+
+ The table below shows how ±0, NaN and
+ ±Infinity are stored.
+
| + | c | +e | +s | +
|---|---|---|---|
| ±0 | +[0] |
+ 0 |
+ ±1 |
+
| NaN | +null |
+ null |
+ null |
+
| ±Infinity | +null |
+ null |
+ ±1 |
+
+x = new Number(-0) // 0 +1 / x == -Infinity // true + +y = new BigNumber(-0) // '0' +y.c // '0' ( [0].toString() ) +y.e // 0 +y.s // -1+ + + +
Errors
+The table below shows the errors that are thrown.
+
+ The errors are generic Error objects whose message begins
+ '[BigNumber Error]'.
+
| Method | +Throws | +
|---|---|
+ BigNumber+ comparedTo+ dividedBy+ dividedToIntegerBy+ isEqualTo+ isGreaterThan+ isGreaterThanOrEqualTo+ isLessThan+ isLessThanOrEqualTo+ minus+ modulo+ plus+ multipliedBy
+ |
+ Base not a primitive number | +
| Base not an integer | +|
| Base out of range | +|
| Number primitive has more than 15 significant digits* | +|
| Not a base... number* | +|
| Not a number* | +|
clone |
+ Object expected | +
config |
+ Object expected | +
DECIMAL_PLACES not a primitive number |
+ |
DECIMAL_PLACES not an integer |
+ |
DECIMAL_PLACES out of range |
+ |
ROUNDING_MODE not a primitive number |
+ |
ROUNDING_MODE not an integer |
+ |
ROUNDING_MODE out of range |
+ |
EXPONENTIAL_AT not a primitive number |
+ |
EXPONENTIAL_AT not an integer |
+ |
EXPONENTIAL_AT out of range |
+ |
RANGE not a primitive number |
+ |
RANGE not an integer |
+ |
RANGE cannot be zero |
+ |
RANGE cannot be zero |
+ |
CRYPTO not true or false |
+ |
crypto unavailable |
+ |
MODULO_MODE not a primitive number |
+ |
MODULO_MODE not an integer |
+ |
MODULO_MODE out of range |
+ |
POW_PRECISION not a primitive number |
+ |
POW_PRECISION not an integer |
+ |
POW_PRECISION out of range |
+ |
FORMAT not an object |
+ |
ALPHABET invalid |
+ |
+ decimalPlaces+ precision+ random+ shiftedBy+ toExponential+ toFixed+ toFormat+ toPrecision
+ |
+ Argument not a primitive number | +
| Argument not an integer | +|
| Argument out of range | +|
+ decimalPlaces+ precision
+ |
+ Argument not true or false | +
exponentiatedBy |
+ Argument not an integer | +
isBigNumber |
+ Invalid BigNumber* | +
+ minimum+ maximum
+ |
+ Not a number* | +
+ random
+ |
+ crypto unavailable | +
+ toFormat
+ |
+ Argument not an object | +
toFraction |
+ Argument not an integer | +
| Argument out of range | +|
toString |
+ Base not a primitive number | +
| Base not an integer | +|
| Base out of range | +
*Only thrown if BigNumber.DEBUG is true.
To determine if an exception is a BigNumber Error:
+
+try {
+ // ...
+} catch (e) {
+ if (e instanceof Error && e.message.indexOf('[BigNumber Error]') === 0) {
+ // ...
+ }
+}
+
+
+
+ Type coercion
+
+ To prevent the accidental use of a BigNumber in primitive number operations, or the
+ accidental addition of a BigNumber to a string, the valueOf method can be safely
+ overwritten as shown below.
+
+ The valueOf method is the same as the
+ toJSON method, and both are the same as the
+ toString method except they do not take a base
+ argument and they include the minus sign for negative zero.
+
+BigNumber.prototype.valueOf = function () {
+ throw Error('valueOf called!')
+}
+
+x = new BigNumber(1)
+x / 2 // '[BigNumber Error] valueOf called!'
+x + 'abc' // '[BigNumber Error] valueOf called!'
+
+
+
+
+ FAQ
+ +Why are trailing fractional zeros removed from BigNumbers?
++ Some arbitrary-precision libraries retain trailing fractional zeros as they can indicate the + precision of a value. This can be useful but the results of arithmetic operations can be + misleading. +
+
+x = new BigDecimal("1.0")
+y = new BigDecimal("1.1000")
+z = x.add(y) // 2.1000
+
+x = new BigDecimal("1.20")
+y = new BigDecimal("3.45000")
+z = x.multiply(y) // 4.1400000
+ + To specify the precision of a value is to specify that the value lies + within a certain range. +
+
+ In the first example, x has a value of 1.0. The trailing zero shows
+ the precision of the value, implying that it is in the range 0.95 to
+ 1.05. Similarly, the precision indicated by the trailing zeros of y
+ indicates that the value is in the range 1.09995 to 1.10005.
+
+ If we add the two lowest values in the ranges we have, 0.95 + 1.09995 = 2.04995,
+ and if we add the two highest values we have, 1.05 + 1.10005 = 2.15005, so the
+ range of the result of the addition implied by the precision of its operands is
+ 2.04995 to 2.15005.
+
+ The result given by BigDecimal of 2.1000 however, indicates that the value is in
+ the range 2.09995 to 2.10005 and therefore the precision implied by
+ its trailing zeros may be misleading.
+
+ In the second example, the true range is 4.122744 to 4.157256 yet
+ the BigDecimal answer of 4.1400000 indicates a range of 4.13999995
+ to 4.14000005. Again, the precision implied by the trailing zeros may be
+ misleading.
+
+ This library, like binary floating point and most calculators, does not retain trailing
+ fractional zeros. Instead, the toExponential, toFixed and
+ toPrecision methods enable trailing zeros to be added if and when required.
+
+
+ Get professional support for this package with a Tidelift subscription
+
+
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. + +
diff --git a/node/node_modules/https-proxy-agent/README.md b/node/node_modules/https-proxy-agent/README.md
new file mode 100644
index 0000000000000000000000000000000000000000..328656a9e048a3f45b1e3e3a91c557865cb5a9a5
--- /dev/null
+++ b/node/node_modules/https-proxy-agent/README.md
@@ -0,0 +1,137 @@
+https-proxy-agent
+================
+### An HTTP(s) proxy `http.Agent` implementation for HTTPS
+[](https://github.com/TooTallNate/node-https-proxy-agent/actions?workflow=Node+CI)
+
+This module provides an `http.Agent` implementation that connects to a specified
+HTTP or HTTPS proxy server, and can be used with the built-in `https` module.
+
+Specifically, this `Agent` implementation connects to an intermediary "proxy"
+server and issues the [CONNECT HTTP method][CONNECT], which tells the proxy to
+open a direct TCP connection to the destination server.
+
+Since this agent implements the CONNECT HTTP method, it also works with other
+protocols that use this method when connecting over proxies (i.e. WebSockets).
+See the "Examples" section below for more.
+
+
+Installation
+------------
+
+Install with `npm`:
+
+``` bash
+$ npm install https-proxy-agent
+```
+
+
+Examples
+--------
+
+#### `https` module example
+
+``` js
+var url = require('url');
+var https = require('https');
+var HttpsProxyAgent = require('https-proxy-agent');
+
+// HTTP/HTTPS proxy to connect to
+var proxy = process.env.http_proxy || 'http://168.63.76.32:3128';
+console.log('using proxy server %j', proxy);
+
+// HTTPS endpoint for the proxy to connect to
+var endpoint = process.argv[2] || 'https://graph.facebook.com/tootallnate';
+console.log('attempting to GET %j', endpoint);
+var options = url.parse(endpoint);
+
+// create an instance of the `HttpsProxyAgent` class with the proxy server information
+var agent = new HttpsProxyAgent(proxy);
+options.agent = agent;
+
+https.get(options, function (res) {
+ console.log('"response" event!', res.headers);
+ res.pipe(process.stdout);
+});
+```
+
+#### `ws` WebSocket connection example
+
+``` js
+var url = require('url');
+var WebSocket = require('ws');
+var HttpsProxyAgent = require('https-proxy-agent');
+
+// HTTP/HTTPS proxy to connect to
+var proxy = process.env.http_proxy || 'http://168.63.76.32:3128';
+console.log('using proxy server %j', proxy);
+
+// WebSocket endpoint for the proxy to connect to
+var endpoint = process.argv[2] || 'ws://echo.websocket.org';
+var parsed = url.parse(endpoint);
+console.log('attempting to connect to WebSocket %j', endpoint);
+
+// create an instance of the `HttpsProxyAgent` class with the proxy server information
+var options = url.parse(proxy);
+
+var agent = new HttpsProxyAgent(options);
+
+// finally, initiate the WebSocket connection
+var socket = new WebSocket(endpoint, { agent: agent });
+
+socket.on('open', function () {
+ console.log('"open" event!');
+ socket.send('hello world');
+});
+
+socket.on('message', function (data, flags) {
+ console.log('"message" event! %j %j', data, flags);
+ socket.close();
+});
+```
+
+API
+---
+
+### new HttpsProxyAgent(Object options)
+
+The `HttpsProxyAgent` class implements an `http.Agent` subclass that connects
+to the specified "HTTP(s) proxy server" in order to proxy HTTPS and/or WebSocket
+requests. This is achieved by using the [HTTP `CONNECT` method][CONNECT].
+
+The `options` argument may either be a string URI of the proxy server to use, or an
+"options" object with more specific properties:
+
+ * `host` - String - Proxy host to connect to (may use `hostname` as well). Required.
+ * `port` - Number - Proxy port to connect to. Required.
+ * `protocol` - String - If `https:`, then use TLS to connect to the proxy.
+ * `headers` - Object - Additional HTTP headers to be sent on the HTTP CONNECT method.
+ * Any other options given are passed to the `net.connect()`/`tls.connect()` functions.
+
+
+License
+-------
+
+(The MIT License)
+
+Copyright (c) 2013 Nathan Rajlich <nathan@tootallnate.net>
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+[CONNECT]: http://en.wikipedia.org/wiki/HTTP_tunnel#HTTP_CONNECT_Tunneling
diff --git a/node/node_modules/https-proxy-agent/dist/agent.d.ts b/node/node_modules/https-proxy-agent/dist/agent.d.ts
new file mode 100644
index 0000000000000000000000000000000000000000..4f1c63624117f043861d040da7e8121916a60429
--- /dev/null
+++ b/node/node_modules/https-proxy-agent/dist/agent.d.ts
@@ -0,0 +1,30 @@
+/// + + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. + +
+
+A tiny JavaScript debugging utility modelled after Node.js core's debugging
+technique. Works in Node.js and web browsers.
+
+## Installation
+
+```bash
+$ npm install debug
+```
+
+## Usage
+
+`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
+
+Example [_app.js_](./examples/node/app.js):
+
+```js
+var debug = require('debug')('http')
+ , http = require('http')
+ , name = 'My App';
+
+// fake app
+
+debug('booting %o', name);
+
+http.createServer(function(req, res){
+ debug(req.method + ' ' + req.url);
+ res.end('hello\n');
+}).listen(3000, function(){
+ debug('listening');
+});
+
+// fake worker of some kind
+
+require('./worker');
+```
+
+Example [_worker.js_](./examples/node/worker.js):
+
+```js
+var a = require('debug')('worker:a')
+ , b = require('debug')('worker:b');
+
+function work() {
+ a('doing lots of uninteresting work');
+ setTimeout(work, Math.random() * 1000);
+}
+
+work();
+
+function workb() {
+ b('doing some work');
+ setTimeout(workb, Math.random() * 2000);
+}
+
+workb();
+```
+
+The `DEBUG` environment variable is then used to enable these based on space or
+comma-delimited names.
+
+Here are some examples:
+
+
+
+
+
+#### Windows command prompt notes
+
+##### CMD
+
+On Windows the environment variable is set using the `set` command.
+
+```cmd
+set DEBUG=*,-not_this
+```
+
+Example:
+
+```cmd
+set DEBUG=* & node app.js
+```
+
+##### PowerShell (VS Code default)
+
+PowerShell uses different syntax to set environment variables.
+
+```cmd
+$env:DEBUG = "*,-not_this"
+```
+
+Example:
+
+```cmd
+$env:DEBUG='app';node app.js
+```
+
+Then, run the program to be debugged as usual.
+
+npm script example:
+```js
+ "windowsDebug": "@powershell -Command $env:DEBUG='*';node app.js",
+```
+
+## Namespace Colors
+
+Every debug instance has a color generated for it based on its namespace name.
+This helps when visually parsing the debug output to identify which debug instance
+a debug line belongs to.
+
+#### Node.js
+
+In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
+the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
+otherwise debug will only use a small handful of basic colors.
+
+
+
+#### Web Browser
+
+Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+option. These are WebKit web inspectors, Firefox ([since version
+31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+and the Firebug plugin for Firefox (any version).
+
+
+
+
+## Millisecond diff
+
+When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+
+
+When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
+
+
+
+
+## Conventions
+
+If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output.
+
+## Wildcards
+
+The `*` character may be used as a wildcard. Suppose for example your library has
+debuggers named "connect:bodyParser", "connect:compress", "connect:session",
+instead of listing all three with
+`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
+`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+You can also exclude specific debuggers by prefixing them with a "-" character.
+For example, `DEBUG=*,-connect:*` would include all debuggers except those
+starting with "connect:".
+
+## Environment Variables
+
+When running through Node.js, you can set a few environment variables that will
+change the behavior of the debug logging:
+
+| Name | Purpose |
+|-----------|-------------------------------------------------|
+| `DEBUG` | Enables/disables specific debugging namespaces. |
+| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY). |
+| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
+| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
+
+
+__Note:__ The environment variables beginning with `DEBUG_` end up being
+converted into an Options object that gets used with `%o`/`%O` formatters.
+See the Node.js documentation for
+[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+for the complete list.
+
+## Formatters
+
+Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
+Below are the officially supported formatters:
+
+| Formatter | Representation |
+|-----------|----------------|
+| `%O` | Pretty-print an Object on multiple lines. |
+| `%o` | Pretty-print an Object all on a single line. |
+| `%s` | String. |
+| `%d` | Number (both integer and float). |
+| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
+| `%%` | Single percent sign ('%'). This does not consume an argument. |
+
+
+### Custom formatters
+
+You can add custom formatters by extending the `debug.formatters` object.
+For example, if you wanted to add support for rendering a Buffer as hex with
+`%h`, you could do something like:
+
+```js
+const createDebug = require('debug')
+createDebug.formatters.h = (v) => {
+ return v.toString('hex')
+}
+
+// …elsewhere
+const debug = createDebug('foo')
+debug('this is hex: %h', new Buffer('hello world'))
+// foo this is hex: 68656c6c6f20776f726c6421 +0ms
+```
+
+
+## Browser Support
+
+You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+if you don't want to build it yourself.
+
+Debug's enable state is currently persisted by `localStorage`.
+Consider the situation shown below where you have `worker:a` and `worker:b`,
+and wish to debug both. You can enable this using `localStorage.debug`:
+
+```js
+localStorage.debug = 'worker:*'
+```
+
+And then refresh the page.
+
+```js
+a = debug('worker:a');
+b = debug('worker:b');
+
+setInterval(function(){
+ a('doing some work');
+}, 1000);
+
+setInterval(function(){
+ b('doing some work');
+}, 1200);
+```
+
+In Chromium-based web browsers (e.g. Brave, Chrome, and Electron), the JavaScript console will—by default—only show messages logged by `debug` if the "Verbose" log level is _enabled_.
+
+
+
+## Output streams
+
+ By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
+
+Example [_stdout.js_](./examples/node/stdout.js):
+
+```js
+var debug = require('debug');
+var error = debug('app:error');
+
+// by default stderr is used
+error('goes to stderr!');
+
+var log = debug('app:log');
+// set this namespace to log via console.log
+log.log = console.log.bind(console); // don't forget to bind to console!
+log('goes to stdout');
+error('still goes to stderr!');
+
+// set all output to go via console.info
+// overrides all per-namespace log settings
+debug.log = console.info.bind(console);
+error('now goes to stdout via console.info');
+log('still goes to stdout, but via console.info now');
+```
+
+## Extend
+You can simply extend debugger
+```js
+const log = require('debug')('auth');
+
+//creates new debug instance with extended namespace
+const logSign = log.extend('sign');
+const logLogin = log.extend('login');
+
+log('hello'); // auth hello
+logSign('hello'); //auth:sign hello
+logLogin('hello'); //auth:login hello
+```
+
+## Set dynamically
+
+You can also enable debug dynamically by calling the `enable()` method :
+
+```js
+let debug = require('debug');
+
+console.log(1, debug.enabled('test'));
+
+debug.enable('test');
+console.log(2, debug.enabled('test'));
+
+debug.disable();
+console.log(3, debug.enabled('test'));
+
+```
+
+print :
+```
+1 false
+2 true
+3 false
+```
+
+Usage :
+`enable(namespaces)`
+`namespaces` can include modes separated by a colon and wildcards.
+
+Note that calling `enable()` completely overrides previously set DEBUG variable :
+
+```
+$ DEBUG=foo node -e 'var dbg = require("debug"); dbg.enable("bar"); console.log(dbg.enabled("foo"))'
+=> false
+```
+
+`disable()`
+
+Will disable all namespaces. The functions returns the namespaces currently
+enabled (and skipped). This can be useful if you want to disable debugging
+temporarily without knowing what was enabled to begin with.
+
+For example:
+
+```js
+let debug = require('debug');
+debug.enable('foo:*,-foo:bar');
+let namespaces = debug.disable();
+debug.enable(namespaces);
+```
+
+Note: There is no guarantee that the string will be identical to the initial
+enable string, but semantically they will be identical.
+
+## Checking whether a debug target is enabled
+
+After you've created a debug instance, you can determine whether or not it is
+enabled by checking the `enabled` property:
+
+```javascript
+const debug = require('debug')('http');
+
+if (debug.enabled) {
+ // do stuff...
+}
+```
+
+You can also manually toggle this property to force the debug instance to be
+enabled or disabled.
+
+## Usage in child processes
+
+Due to the way `debug` detects if the output is a TTY or not, colors are not shown in child processes when `stderr` is piped. A solution is to pass the `DEBUG_COLORS=1` environment variable to the child process.
+For example:
+
+```javascript
+worker = fork(WORKER_WRAP_PATH, [workerPath], {
+ stdio: [
+ /* stdin: */ 0,
+ /* stdout: */ 'pipe',
+ /* stderr: */ 'pipe',
+ 'ipc',
+ ],
+ env: Object.assign({}, process.env, {
+ DEBUG_COLORS: 1 // without this settings, colors won't be shown
+ }),
+});
+
+worker.stderr.pipe(process.stderr, { end: false });
+```
+
+
+## Authors
+
+ - TJ Holowaychuk
+ - Nathan Rajlich
+ - Andrew Rhyne
+ - Josh Junon
+
+## Backers
+
+Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+## Sponsors
+
+Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)]
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca>
+Copyright (c) 2018-2021 Josh Junon
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node/node_modules/https-proxy-agent/node_modules/debug/package.json b/node/node_modules/https-proxy-agent/node_modules/debug/package.json
new file mode 100644
index 0000000000000000000000000000000000000000..3bcdc242fc0675883ce46ba5dca919d116c46a83
--- /dev/null
+++ b/node/node_modules/https-proxy-agent/node_modules/debug/package.json
@@ -0,0 +1,59 @@
+{
+ "name": "debug",
+ "version": "4.3.4",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/debug-js/debug.git"
+ },
+ "description": "Lightweight debugging utility for Node.js and the browser",
+ "keywords": [
+ "debug",
+ "log",
+ "debugger"
+ ],
+ "files": [
+ "src",
+ "LICENSE",
+ "README.md"
+ ],
+ "author": "Josh Junon
+
+ Get professional support for this package with a Tidelift subscription
+
+
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. + +
diff --git a/node/node_modules/json-bigint/LICENSE b/node/node_modules/json-bigint/LICENSE
new file mode 100644
index 0000000000000000000000000000000000000000..9ab4d83bf1dcb0cc005f37677f74f9808da0a08d
--- /dev/null
+++ b/node/node_modules/json-bigint/LICENSE
@@ -0,0 +1,20 @@
+The MIT License (MIT)
+
+Copyright (c) 2013 Andrey Sidorov
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of
+the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS
+FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR
+COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER
+IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
+CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node/node_modules/json-bigint/README.md b/node/node_modules/json-bigint/README.md
new file mode 100644
index 0000000000000000000000000000000000000000..e7335c73b9694a8a8f6682c0805a14268664acd6
--- /dev/null
+++ b/node/node_modules/json-bigint/README.md
@@ -0,0 +1,240 @@
+# json-bigint
+
+[](http://travis-ci.org/sidorares/json-bigint)
+[](https://nodei.co/npm/json-bigint/)
+
+JSON.parse/stringify with bigints support. Based on Douglas Crockford [JSON.js](https://github.com/douglascrockford/JSON-js) package and [bignumber.js](https://github.com/MikeMcl/bignumber.js) library.
+
+Native `Bigint` was added to JS recently, so we added an option to leverage it instead of `bignumber.js`. However, the parsing with native `BigInt` is kept an option for backward compability.
+
+While most JSON parsers assume numeric values have same precision restrictions as IEEE 754 double, JSON specification _does not_ say anything about number precision. Any floating point number in decimal (optionally scientific) notation is valid JSON value. It's a good idea to serialize values which might fall out of IEEE 754 integer precision as strings in your JSON api, but `{ "value" : 9223372036854775807}`, for example, is still a valid RFC4627 JSON string, and in most JS runtimes the result of `JSON.parse` is this object: `{ value: 9223372036854776000 }`
+
+==========
+
+example:
+
+```js
+var JSONbig = require('json-bigint');
+
+var json = '{ "value" : 9223372036854775807, "v2": 123 }';
+console.log('Input:', json);
+console.log('');
+
+console.log('node.js built-in JSON:');
+var r = JSON.parse(json);
+console.log('JSON.parse(input).value : ', r.value.toString());
+console.log('JSON.stringify(JSON.parse(input)):', JSON.stringify(r));
+
+console.log('\n\nbig number JSON:');
+var r1 = JSONbig.parse(json);
+console.log('JSONbig.parse(input).value : ', r1.value.toString());
+console.log('JSONbig.stringify(JSONbig.parse(input)):', JSONbig.stringify(r1));
+```
+
+Output:
+
+```
+Input: { "value" : 9223372036854775807, "v2": 123 }
+
+node.js built-in JSON:
+JSON.parse(input).value : 9223372036854776000
+JSON.stringify(JSON.parse(input)): {"value":9223372036854776000,"v2":123}
+
+
+big number JSON:
+JSONbig.parse(input).value : 9223372036854775807
+JSONbig.stringify(JSONbig.parse(input)): {"value":9223372036854775807,"v2":123}
+```
+
+### Options
+
+The behaviour of the parser is somewhat configurable through 'options'
+
+#### options.strict, boolean, default false
+
+Specifies the parsing should be "strict" towards reporting duplicate-keys in the parsed string.
+The default follows what is allowed in standard json and resembles the behavior of JSON.parse, but overwrites any previous values with the last one assigned to the duplicate-key.
+
+Setting options.strict = true will fail-fast on such duplicate-key occurances and thus warn you upfront of possible lost information.
+
+example:
+
+```js
+var JSONbig = require('json-bigint');
+var JSONstrict = require('json-bigint')({ strict: true });
+
+var dupkeys = '{ "dupkey": "value 1", "dupkey": "value 2"}';
+console.log('\n\nDuplicate Key test with both lenient and strict JSON parsing');
+console.log('Input:', dupkeys);
+var works = JSONbig.parse(dupkeys);
+console.log('JSON.parse(dupkeys).dupkey: %s', works.dupkey);
+var fails = 'will stay like this';
+try {
+ fails = JSONstrict.parse(dupkeys);
+ console.log('ERROR!! Should never get here');
+} catch (e) {
+ console.log(
+ 'Succesfully catched expected exception on duplicate keys: %j',
+ e
+ );
+}
+```
+
+Output
+
+```
+Duplicate Key test with big number JSON
+Input: { "dupkey": "value 1", "dupkey": "value 2"}
+JSON.parse(dupkeys).dupkey: value 2
+Succesfully catched expected exception on duplicate keys: {"name":"SyntaxError","message":"Duplicate key \"dupkey\"","at":33,"text":"{ \"dupkey\": \"value 1\", \"dupkey\": \"value 2\"}"}
+
+```
+
+#### options.storeAsString, boolean, default false
+
+Specifies if BigInts should be stored in the object as a string, rather than the default BigNumber.
+
+Note that this is a dangerous behavior as it breaks the default functionality of being able to convert back-and-forth without data type changes (as this will convert all BigInts to be-and-stay strings).
+
+example:
+
+```js
+var JSONbig = require('json-bigint');
+var JSONbigString = require('json-bigint')({ storeAsString: true });
+var key = '{ "key": 1234567890123456789 }';
+console.log('\n\nStoring the BigInt as a string, instead of a BigNumber');
+console.log('Input:', key);
+var withInt = JSONbig.parse(key);
+var withString = JSONbigString.parse(key);
+console.log(
+ 'Default type: %s, With option type: %s',
+ typeof withInt.key,
+ typeof withString.key
+);
+```
+
+Output
+
+```
+Storing the BigInt as a string, instead of a BigNumber
+Input: { "key": 1234567890123456789 }
+Default type: object, With option type: string
+
+```
+
+#### options.useNativeBigInt, boolean, default false
+
+Specifies if parser uses native BigInt instead of bignumber.js
+
+example:
+
+```js
+var JSONbig = require('json-bigint');
+var JSONbigNative = require('json-bigint')({ useNativeBigInt: true });
+var key = '{ "key": 993143214321423154315154321 }';
+console.log(`\n\nStoring the Number as native BigInt, instead of a BigNumber`);
+console.log('Input:', key);
+var normal = JSONbig.parse(key);
+var nativeBigInt = JSONbigNative.parse(key);
+console.log(
+ 'Default type: %s, With option type: %s',
+ typeof normal.key,
+ typeof nativeBigInt.key
+);
+```
+
+Output
+
+```
+Storing the Number as native BigInt, instead of a BigNumber
+Input: { "key": 993143214321423154315154321 }
+Default type: object, With option type: bigint
+
+```
+
+#### options.alwaysParseAsBig, boolean, default false
+
+Specifies if all numbers should be stored as BigNumber.
+
+Note that this is a dangerous behavior as it breaks the default functionality of being able to convert back-and-forth without data type changes (as this will convert all Number to be-and-stay BigNumber)
+
+example:
+
+```js
+var JSONbig = require('json-bigint');
+var JSONbigAlways = require('json-bigint')({ alwaysParseAsBig: true });
+var key = '{ "key": 123 }'; // there is no need for BigNumber by default, but we're forcing it
+console.log(`\n\nStoring the Number as a BigNumber, instead of a Number`);
+console.log('Input:', key);
+var normal = JSONbig.parse(key);
+var always = JSONbigAlways.parse(key);
+console.log(
+ 'Default type: %s, With option type: %s',
+ typeof normal.key,
+ typeof always.key
+);
+```
+
+Output
+
+```
+Storing the Number as a BigNumber, instead of a Number
+Input: { "key": 123 }
+Default type: number, With option type: object
+
+```
+
+If you want to force all numbers to be parsed as native `BigInt`
+(you probably do! Otherwise any calulations become a real headache):
+
+```js
+var JSONbig = require('json-bigint')({
+ alwaysParseAsBig: true,
+ useNativeBigInt: true,
+});
+```
+
+#### options.protoAction, boolean, default: "error". Possible values: "error", "ignore", "preserve"
+
+#### options.constructorAction, boolean, default: "error". Possible values: "error", "ignore", "preserve"
+
+Controls how `__proto__` and `constructor` properties are treated. If set to "error" they are not allowed and
+parse() call will throw an error. If set to "ignore" the prroperty and it;s value is skipped from parsing and object building.
+If set to "preserve" the `__proto__` property is set. One should be extra careful and make sure any other library consuming generated data
+is not vulnerable to prototype poisoning attacks.
+
+example:
+
+```js
+var JSONbigAlways = require('json-bigint')({ protoAction: 'ignore' });
+const user = JSONbig.parse('{ "__proto__": { "admin": true }, "id": 12345 }');
+// => result is { id: 12345 }
+```
+
+### Links:
+
+- [RFC4627: The application/json Media Type for JavaScript Object Notation (JSON)](http://www.ietf.org/rfc/rfc4627.txt)
+- [Re: \[Json\] Limitations on number size?](http://www.ietf.org/mail-archive/web/json/current/msg00297.html)
+- [Is there any proper way to parse JSON with large numbers? (long, bigint, int64)](http://stackoverflow.com/questions/18755125/node-js-is-there-any-proper-way-to-parse-json-with-large-numbers-long-bigint)
+- [What is JavaScript's Max Int? What's the highest Integer value a Number can go to without losing precision?](http://stackoverflow.com/questions/307179/what-is-javascripts-max-int-whats-the-highest-integer-value-a-number-can-go-t)
+- [Large numbers erroneously rounded in Javascript](http://stackoverflow.com/questions/1379934/large-numbers-erroneously-rounded-in-javascript)
+
+### Note on native BigInt support
+
+#### Stringifying
+
+Full support out-of-the-box, stringifies BigInts as pure numbers (no quotes, no `n`)
+
+#### Limitations
+
+- Roundtrip operations
+
+`s === JSONbig.stringify(JSONbig.parse(s))` but
+
+`o !== JSONbig.parse(JSONbig.stringify(o))`
+
+when `o` has a value with something like `123n`.
+
+`JSONbig` stringify `123n` as `123`, which becomes `number` (aka `123` not `123n`) by default when being reparsed.
+
+There is currently no consistent way to deal with this issue, so we decided to leave it, handling this specific case is then up to users.
diff --git a/node/node_modules/json-bigint/index.js b/node/node_modules/json-bigint/index.js
new file mode 100644
index 0000000000000000000000000000000000000000..4757600b387bbaf560314b8932d539428f582dba
--- /dev/null
+++ b/node/node_modules/json-bigint/index.js
@@ -0,0 +1,12 @@
+var json_stringify = require('./lib/stringify.js').stringify;
+var json_parse = require('./lib/parse.js');
+
+module.exports = function(options) {
+ return {
+ parse: json_parse(options),
+ stringify: json_stringify
+ }
+};
+//create the default method members with no options applied for backwards compatibility
+module.exports.parse = json_parse();
+module.exports.stringify = json_stringify;
diff --git a/node/node_modules/json-bigint/lib/parse.js b/node/node_modules/json-bigint/lib/parse.js
new file mode 100644
index 0000000000000000000000000000000000000000..bb4e5ebf2e8717ae77b5147668685055c064c098
--- /dev/null
+++ b/node/node_modules/json-bigint/lib/parse.js
@@ -0,0 +1,443 @@
+var BigNumber = null;
+
+// regexpxs extracted from
+// (c) BSD-3-Clause
+// https://github.com/fastify/secure-json-parse/graphs/contributors and https://github.com/hapijs/bourne/graphs/contributors
+
+const suspectProtoRx = /(?:_|\\u005[Ff])(?:_|\\u005[Ff])(?:p|\\u0070)(?:r|\\u0072)(?:o|\\u006[Ff])(?:t|\\u0074)(?:o|\\u006[Ff])(?:_|\\u005[Ff])(?:_|\\u005[Ff])/;
+const suspectConstructorRx = /(?:c|\\u0063)(?:o|\\u006[Ff])(?:n|\\u006[Ee])(?:s|\\u0073)(?:t|\\u0074)(?:r|\\u0072)(?:u|\\u0075)(?:c|\\u0063)(?:t|\\u0074)(?:o|\\u006[Ff])(?:r|\\u0072)/;
+
+/*
+ json_parse.js
+ 2012-06-20
+
+ Public Domain.
+
+ NO WARRANTY EXPRESSED OR IMPLIED. USE AT YOUR OWN RISK.
+
+ This file creates a json_parse function.
+ During create you can (optionally) specify some behavioural switches
+
+ require('json-bigint')(options)
+
+ The optional options parameter holds switches that drive certain
+ aspects of the parsing process:
+ * options.strict = true will warn about duplicate-key usage in the json.
+ The default (strict = false) will silently ignore those and overwrite
+ values for keys that are in duplicate use.
+
+ The resulting function follows this signature:
+ json_parse(text, reviver)
+ This method parses a JSON text to produce an object or array.
+ It can throw a SyntaxError exception.
+
+ The optional reviver parameter is a function that can filter and
+ transform the results. It receives each of the keys and values,
+ and its return value is used instead of the original value.
+ If it returns what it received, then the structure is not modified.
+ If it returns undefined then the member is deleted.
+
+ Example:
+
+ // Parse the text. Values that look like ISO date strings will
+ // be converted to Date objects.
+
+ myData = json_parse(text, function (key, value) {
+ var a;
+ if (typeof value === 'string') {
+ a =
+/^(\d{4})-(\d{2})-(\d{2})T(\d{2}):(\d{2}):(\d{2}(?:\.\d*)?)Z$/.exec(value);
+ if (a) {
+ return new Date(Date.UTC(+a[1], +a[2] - 1, +a[3], +a[4],
+ +a[5], +a[6]));
+ }
+ }
+ return value;
+ });
+
+ This is a reference implementation. You are free to copy, modify, or
+ redistribute.
+
+ This code should be minified before deployment.
+ See http://javascript.crockford.com/jsmin.html
+
+ USE YOUR OWN COPY. IT IS EXTREMELY UNWISE TO LOAD CODE FROM SERVERS YOU DO
+ NOT CONTROL.
+*/
+
+/*members "", "\"", "\/", "\\", at, b, call, charAt, f, fromCharCode,
+ hasOwnProperty, message, n, name, prototype, push, r, t, text
+*/
+
+var json_parse = function (options) {
+ 'use strict';
+
+ // This is a function that can parse a JSON text, producing a JavaScript
+ // data structure. It is a simple, recursive descent parser. It does not use
+ // eval or regular expressions, so it can be used as a model for implementing
+ // a JSON parser in other languages.
+
+ // We are defining the function inside of another function to avoid creating
+ // global variables.
+
+ // Default options one can override by passing options to the parse()
+ var _options = {
+ strict: false, // not being strict means do not generate syntax errors for "duplicate key"
+ storeAsString: false, // toggles whether the values should be stored as BigNumber (default) or a string
+ alwaysParseAsBig: false, // toggles whether all numbers should be Big
+ useNativeBigInt: false, // toggles whether to use native BigInt instead of bignumber.js
+ protoAction: 'error',
+ constructorAction: 'error',
+ };
+
+ // If there are options, then use them to override the default _options
+ if (options !== undefined && options !== null) {
+ if (options.strict === true) {
+ _options.strict = true;
+ }
+ if (options.storeAsString === true) {
+ _options.storeAsString = true;
+ }
+ _options.alwaysParseAsBig =
+ options.alwaysParseAsBig === true ? options.alwaysParseAsBig : false;
+ _options.useNativeBigInt =
+ options.useNativeBigInt === true ? options.useNativeBigInt : false;
+
+ if (typeof options.constructorAction !== 'undefined') {
+ if (
+ options.constructorAction === 'error' ||
+ options.constructorAction === 'ignore' ||
+ options.constructorAction === 'preserve'
+ ) {
+ _options.constructorAction = options.constructorAction;
+ } else {
+ throw new Error(
+ `Incorrect value for constructorAction option, must be "error", "ignore" or undefined but passed ${options.constructorAction}`
+ );
+ }
+ }
+
+ if (typeof options.protoAction !== 'undefined') {
+ if (
+ options.protoAction === 'error' ||
+ options.protoAction === 'ignore' ||
+ options.protoAction === 'preserve'
+ ) {
+ _options.protoAction = options.protoAction;
+ } else {
+ throw new Error(
+ `Incorrect value for protoAction option, must be "error", "ignore" or undefined but passed ${options.protoAction}`
+ );
+ }
+ }
+ }
+
+ var at, // The index of the current character
+ ch, // The current character
+ escapee = {
+ '"': '"',
+ '\\': '\\',
+ '/': '/',
+ b: '\b',
+ f: '\f',
+ n: '\n',
+ r: '\r',
+ t: '\t',
+ },
+ text,
+ error = function (m) {
+ // Call error when something is wrong.
+
+ throw {
+ name: 'SyntaxError',
+ message: m,
+ at: at,
+ text: text,
+ };
+ },
+ next = function (c) {
+ // If a c parameter is provided, verify that it matches the current character.
+
+ if (c && c !== ch) {
+ error("Expected '" + c + "' instead of '" + ch + "'");
+ }
+
+ // Get the next character. When there are no more characters,
+ // return the empty string.
+
+ ch = text.charAt(at);
+ at += 1;
+ return ch;
+ },
+ number = function () {
+ // Parse a number value.
+
+ var number,
+ string = '';
+
+ if (ch === '-') {
+ string = '-';
+ next('-');
+ }
+ while (ch >= '0' && ch <= '9') {
+ string += ch;
+ next();
+ }
+ if (ch === '.') {
+ string += '.';
+ while (next() && ch >= '0' && ch <= '9') {
+ string += ch;
+ }
+ }
+ if (ch === 'e' || ch === 'E') {
+ string += ch;
+ next();
+ if (ch === '-' || ch === '+') {
+ string += ch;
+ next();
+ }
+ while (ch >= '0' && ch <= '9') {
+ string += ch;
+ next();
+ }
+ }
+ number = +string;
+ if (!isFinite(number)) {
+ error('Bad number');
+ } else {
+ if (BigNumber == null) BigNumber = require('bignumber.js');
+ //if (number > 9007199254740992 || number < -9007199254740992)
+ // Bignumber has stricter check: everything with length > 15 digits disallowed
+ if (string.length > 15)
+ return _options.storeAsString
+ ? string
+ : _options.useNativeBigInt
+ ? BigInt(string)
+ : new BigNumber(string);
+ else
+ return !_options.alwaysParseAsBig
+ ? number
+ : _options.useNativeBigInt
+ ? BigInt(number)
+ : new BigNumber(number);
+ }
+ },
+ string = function () {
+ // Parse a string value.
+
+ var hex,
+ i,
+ string = '',
+ uffff;
+
+ // When parsing for string values, we must look for " and \ characters.
+
+ if (ch === '"') {
+ var startAt = at;
+ while (next()) {
+ if (ch === '"') {
+ if (at - 1 > startAt) string += text.substring(startAt, at - 1);
+ next();
+ return string;
+ }
+ if (ch === '\\') {
+ if (at - 1 > startAt) string += text.substring(startAt, at - 1);
+ next();
+ if (ch === 'u') {
+ uffff = 0;
+ for (i = 0; i < 4; i += 1) {
+ hex = parseInt(next(), 16);
+ if (!isFinite(hex)) {
+ break;
+ }
+ uffff = uffff * 16 + hex;
+ }
+ string += String.fromCharCode(uffff);
+ } else if (typeof escapee[ch] === 'string') {
+ string += escapee[ch];
+ } else {
+ break;
+ }
+ startAt = at;
+ }
+ }
+ }
+ error('Bad string');
+ },
+ white = function () {
+ // Skip whitespace.
+
+ while (ch && ch <= ' ') {
+ next();
+ }
+ },
+ word = function () {
+ // true, false, or null.
+
+ switch (ch) {
+ case 't':
+ next('t');
+ next('r');
+ next('u');
+ next('e');
+ return true;
+ case 'f':
+ next('f');
+ next('a');
+ next('l');
+ next('s');
+ next('e');
+ return false;
+ case 'n':
+ next('n');
+ next('u');
+ next('l');
+ next('l');
+ return null;
+ }
+ error("Unexpected '" + ch + "'");
+ },
+ value, // Place holder for the value function.
+ array = function () {
+ // Parse an array value.
+
+ var array = [];
+
+ if (ch === '[') {
+ next('[');
+ white();
+ if (ch === ']') {
+ next(']');
+ return array; // empty array
+ }
+ while (ch) {
+ array.push(value());
+ white();
+ if (ch === ']') {
+ next(']');
+ return array;
+ }
+ next(',');
+ white();
+ }
+ }
+ error('Bad array');
+ },
+ object = function () {
+ // Parse an object value.
+
+ var key,
+ object = Object.create(null);
+
+ if (ch === '{') {
+ next('{');
+ white();
+ if (ch === '}') {
+ next('}');
+ return object; // empty object
+ }
+ while (ch) {
+ key = string();
+ white();
+ next(':');
+ if (
+ _options.strict === true &&
+ Object.hasOwnProperty.call(object, key)
+ ) {
+ error('Duplicate key "' + key + '"');
+ }
+
+ if (suspectProtoRx.test(key) === true) {
+ if (_options.protoAction === 'error') {
+ error('Object contains forbidden prototype property');
+ } else if (_options.protoAction === 'ignore') {
+ value();
+ } else {
+ object[key] = value();
+ }
+ } else if (suspectConstructorRx.test(key) === true) {
+ if (_options.constructorAction === 'error') {
+ error('Object contains forbidden constructor property');
+ } else if (_options.constructorAction === 'ignore') {
+ value();
+ } else {
+ object[key] = value();
+ }
+ } else {
+ object[key] = value();
+ }
+
+ white();
+ if (ch === '}') {
+ next('}');
+ return object;
+ }
+ next(',');
+ white();
+ }
+ }
+ error('Bad object');
+ };
+
+ value = function () {
+ // Parse a JSON value. It could be an object, an array, a string, a number,
+ // or a word.
+
+ white();
+ switch (ch) {
+ case '{':
+ return object();
+ case '[':
+ return array();
+ case '"':
+ return string();
+ case '-':
+ return number();
+ default:
+ return ch >= '0' && ch <= '9' ? number() : word();
+ }
+ };
+
+ // Return the json_parse function. It will have access to all of the above
+ // functions and variables.
+
+ return function (source, reviver) {
+ var result;
+
+ text = source + '';
+ at = 0;
+ ch = ' ';
+ result = value();
+ white();
+ if (ch) {
+ error('Syntax error');
+ }
+
+ // If there is a reviver function, we recursively walk the new structure,
+ // passing each name/value pair to the reviver function for possible
+ // transformation, starting with a temporary root object that holds the result
+ // in an empty key. If there is not a reviver function, we simply return the
+ // result.
+
+ return typeof reviver === 'function'
+ ? (function walk(holder, key) {
+ var k,
+ v,
+ value = holder[key];
+ if (value && typeof value === 'object') {
+ Object.keys(value).forEach(function (k) {
+ v = walk(value, k);
+ if (v !== undefined) {
+ value[k] = v;
+ } else {
+ delete value[k];
+ }
+ });
+ }
+ return reviver.call(holder, key, value);
+ })({ '': result }, '')
+ : result;
+ };
+};
+
+module.exports = json_parse;
diff --git a/node/node_modules/json-bigint/lib/stringify.js b/node/node_modules/json-bigint/lib/stringify.js
new file mode 100644
index 0000000000000000000000000000000000000000..3bd526993aedd9875b688bd5e3d8363b533e0063
--- /dev/null
+++ b/node/node_modules/json-bigint/lib/stringify.js
@@ -0,0 +1,384 @@
+var BigNumber = require('bignumber.js');
+
+/*
+ json2.js
+ 2013-05-26
+
+ Public Domain.
+
+ NO WARRANTY EXPRESSED OR IMPLIED. USE AT YOUR OWN RISK.
+
+ See http://www.JSON.org/js.html
+
+
+ This code should be minified before deployment.
+ See http://javascript.crockford.com/jsmin.html
+
+ USE YOUR OWN COPY. IT IS EXTREMELY UNWISE TO LOAD CODE FROM SERVERS YOU DO
+ NOT CONTROL.
+
+
+ This file creates a global JSON object containing two methods: stringify
+ and parse.
+
+ JSON.stringify(value, replacer, space)
+ value any JavaScript value, usually an object or array.
+
+ replacer an optional parameter that determines how object
+ values are stringified for objects. It can be a
+ function or an array of strings.
+
+ space an optional parameter that specifies the indentation
+ of nested structures. If it is omitted, the text will
+ be packed without extra whitespace. If it is a number,
+ it will specify the number of spaces to indent at each
+ level. If it is a string (such as '\t' or ' '),
+ it contains the characters used to indent at each level.
+
+ This method produces a JSON text from a JavaScript value.
+
+ When an object value is found, if the object contains a toJSON
+ method, its toJSON method will be called and the result will be
+ stringified. A toJSON method does not serialize: it returns the
+ value represented by the name/value pair that should be serialized,
+ or undefined if nothing should be serialized. The toJSON method
+ will be passed the key associated with the value, and this will be
+ bound to the value
+
+ For example, this would serialize Dates as ISO strings.
+
+ Date.prototype.toJSON = function (key) {
+ function f(n) {
+ // Format integers to have at least two digits.
+ return n < 10 ? '0' + n : n;
+ }
+
+ return this.getUTCFullYear() + '-' +
+ f(this.getUTCMonth() + 1) + '-' +
+ f(this.getUTCDate()) + 'T' +
+ f(this.getUTCHours()) + ':' +
+ f(this.getUTCMinutes()) + ':' +
+ f(this.getUTCSeconds()) + 'Z';
+ };
+
+ You can provide an optional replacer method. It will be passed the
+ key and value of each member, with this bound to the containing
+ object. The value that is returned from your method will be
+ serialized. If your method returns undefined, then the member will
+ be excluded from the serialization.
+
+ If the replacer parameter is an array of strings, then it will be
+ used to select the members to be serialized. It filters the results
+ such that only members with keys listed in the replacer array are
+ stringified.
+
+ Values that do not have JSON representations, such as undefined or
+ functions, will not be serialized. Such values in objects will be
+ dropped; in arrays they will be replaced with null. You can use
+ a replacer function to replace those with JSON values.
+ JSON.stringify(undefined) returns undefined.
+
+ The optional space parameter produces a stringification of the
+ value that is filled with line breaks and indentation to make it
+ easier to read.
+
+ If the space parameter is a non-empty string, then that string will
+ be used for indentation. If the space parameter is a number, then
+ the indentation will be that many spaces.
+
+ Example:
+
+ text = JSON.stringify(['e', {pluribus: 'unum'}]);
+ // text is '["e",{"pluribus":"unum"}]'
+
+
+ text = JSON.stringify(['e', {pluribus: 'unum'}], null, '\t');
+ // text is '[\n\t"e",\n\t{\n\t\t"pluribus": "unum"\n\t}\n]'
+
+ text = JSON.stringify([new Date()], function (key, value) {
+ return this[key] instanceof Date ?
+ 'Date(' + this[key] + ')' : value;
+ });
+ // text is '["Date(---current time---)"]'
+
+
+ JSON.parse(text, reviver)
+ This method parses a JSON text to produce an object or array.
+ It can throw a SyntaxError exception.
+
+ The optional reviver parameter is a function that can filter and
+ transform the results. It receives each of the keys and values,
+ and its return value is used instead of the original value.
+ If it returns what it received, then the structure is not modified.
+ If it returns undefined then the member is deleted.
+
+ Example:
+
+ // Parse the text. Values that look like ISO date strings will
+ // be converted to Date objects.
+
+ myData = JSON.parse(text, function (key, value) {
+ var a;
+ if (typeof value === 'string') {
+ a =
+/^(\d{4})-(\d{2})-(\d{2})T(\d{2}):(\d{2}):(\d{2}(?:\.\d*)?)Z$/.exec(value);
+ if (a) {
+ return new Date(Date.UTC(+a[1], +a[2] - 1, +a[3], +a[4],
+ +a[5], +a[6]));
+ }
+ }
+ return value;
+ });
+
+ myData = JSON.parse('["Date(09/09/2001)"]', function (key, value) {
+ var d;
+ if (typeof value === 'string' &&
+ value.slice(0, 5) === 'Date(' &&
+ value.slice(-1) === ')') {
+ d = new Date(value.slice(5, -1));
+ if (d) {
+ return d;
+ }
+ }
+ return value;
+ });
+
+
+ This is a reference implementation. You are free to copy, modify, or
+ redistribute.
+*/
+
+/*jslint evil: true, regexp: true */
+
+/*members "", "\b", "\t", "\n", "\f", "\r", "\"", JSON, "\\", apply,
+ call, charCodeAt, getUTCDate, getUTCFullYear, getUTCHours,
+ getUTCMinutes, getUTCMonth, getUTCSeconds, hasOwnProperty, join,
+ lastIndex, length, parse, prototype, push, replace, slice, stringify,
+ test, toJSON, toString, valueOf
+*/
+
+
+// Create a JSON object only if one does not already exist. We create the
+// methods in a closure to avoid creating global variables.
+
+var JSON = module.exports;
+
+(function () {
+ 'use strict';
+
+ function f(n) {
+ // Format integers to have at least two digits.
+ return n < 10 ? '0' + n : n;
+ }
+
+ var cx = /[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,
+ escapable = /[\\\"\x00-\x1f\x7f-\x9f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,
+ gap,
+ indent,
+ meta = { // table of character substitutions
+ '\b': '\\b',
+ '\t': '\\t',
+ '\n': '\\n',
+ '\f': '\\f',
+ '\r': '\\r',
+ '"' : '\\"',
+ '\\': '\\\\'
+ },
+ rep;
+
+
+ function quote(string) {
+
+// If the string contains no control characters, no quote characters, and no
+// backslash characters, then we can safely slap some quotes around it.
+// Otherwise we must also replace the offending characters with safe escape
+// sequences.
+
+ escapable.lastIndex = 0;
+ return escapable.test(string) ? '"' + string.replace(escapable, function (a) {
+ var c = meta[a];
+ return typeof c === 'string'
+ ? c
+ : '\\u' + ('0000' + a.charCodeAt(0).toString(16)).slice(-4);
+ }) + '"' : '"' + string + '"';
+ }
+
+
+ function str(key, holder) {
+
+// Produce a string from holder[key].
+
+ var i, // The loop counter.
+ k, // The member key.
+ v, // The member value.
+ length,
+ mind = gap,
+ partial,
+ value = holder[key],
+ isBigNumber = value != null && (value instanceof BigNumber || BigNumber.isBigNumber(value));
+
+// If the value has a toJSON method, call it to obtain a replacement value.
+
+ if (value && typeof value === 'object' &&
+ typeof value.toJSON === 'function') {
+ value = value.toJSON(key);
+ }
+
+// If we were called with a replacer function, then call the replacer to
+// obtain a replacement value.
+
+ if (typeof rep === 'function') {
+ value = rep.call(holder, key, value);
+ }
+
+// What happens next depends on the value's type.
+
+ switch (typeof value) {
+ case 'string':
+ if (isBigNumber) {
+ return value;
+ } else {
+ return quote(value);
+ }
+
+ case 'number':
+
+// JSON numbers must be finite. Encode non-finite numbers as null.
+
+ return isFinite(value) ? String(value) : 'null';
+
+ case 'boolean':
+ case 'null':
+ case 'bigint':
+
+// If the value is a boolean or null, convert it to a string. Note:
+// typeof null does not produce 'null'. The case is included here in
+// the remote chance that this gets fixed someday.
+
+ return String(value);
+
+// If the type is 'object', we might be dealing with an object or an array or
+// null.
+
+ case 'object':
+
+// Due to a specification blunder in ECMAScript, typeof null is 'object',
+// so watch out for that case.
+
+ if (!value) {
+ return 'null';
+ }
+
+// Make an array to hold the partial results of stringifying this object value.
+
+ gap += indent;
+ partial = [];
+
+// Is the value an array?
+
+ if (Object.prototype.toString.apply(value) === '[object Array]') {
+
+// The value is an array. Stringify every element. Use null as a placeholder
+// for non-JSON values.
+
+ length = value.length;
+ for (i = 0; i < length; i += 1) {
+ partial[i] = str(i, value) || 'null';
+ }
+
+// Join all of the elements together, separated with commas, and wrap them in
+// brackets.
+
+ v = partial.length === 0
+ ? '[]'
+ : gap
+ ? '[\n' + gap + partial.join(',\n' + gap) + '\n' + mind + ']'
+ : '[' + partial.join(',') + ']';
+ gap = mind;
+ return v;
+ }
+
+// If the replacer is an array, use it to select the members to be stringified.
+
+ if (rep && typeof rep === 'object') {
+ length = rep.length;
+ for (i = 0; i < length; i += 1) {
+ if (typeof rep[i] === 'string') {
+ k = rep[i];
+ v = str(k, value);
+ if (v) {
+ partial.push(quote(k) + (gap ? ': ' : ':') + v);
+ }
+ }
+ }
+ } else {
+
+// Otherwise, iterate through all of the keys in the object.
+
+ Object.keys(value).forEach(function(k) {
+ var v = str(k, value);
+ if (v) {
+ partial.push(quote(k) + (gap ? ': ' : ':') + v);
+ }
+ });
+ }
+
+// Join all of the member texts together, separated with commas,
+// and wrap them in braces.
+
+ v = partial.length === 0
+ ? '{}'
+ : gap
+ ? '{\n' + gap + partial.join(',\n' + gap) + '\n' + mind + '}'
+ : '{' + partial.join(',') + '}';
+ gap = mind;
+ return v;
+ }
+ }
+
+// If the JSON object does not yet have a stringify method, give it one.
+
+ if (typeof JSON.stringify !== 'function') {
+ JSON.stringify = function (value, replacer, space) {
+
+// The stringify method takes a value and an optional replacer, and an optional
+// space parameter, and returns a JSON text. The replacer can be a function
+// that can replace values, or an array of strings that will select the keys.
+// A default replacer method can be provided. Use of the space parameter can
+// produce text that is more easily readable.
+
+ var i;
+ gap = '';
+ indent = '';
+
+// If the space parameter is a number, make an indent string containing that
+// many spaces.
+
+ if (typeof space === 'number') {
+ for (i = 0; i < space; i += 1) {
+ indent += ' ';
+ }
+
+// If the space parameter is a string, it will be used as the indent string.
+
+ } else if (typeof space === 'string') {
+ indent = space;
+ }
+
+// If there is a replacer, it must be a function or an array.
+// Otherwise, throw an error.
+
+ rep = replacer;
+ if (replacer && typeof replacer !== 'function' &&
+ (typeof replacer !== 'object' ||
+ typeof replacer.length !== 'number')) {
+ throw new Error('JSON.stringify');
+ }
+
+// Make a fake root object containing our value under the key of ''.
+// Return the result of stringifying the value.
+
+ return str('', {'': value});
+ };
+ }
+}());
diff --git a/node/node_modules/json-bigint/package.json b/node/node_modules/json-bigint/package.json
new file mode 100644
index 0000000000000000000000000000000000000000..9309f6b2c41e153936ac5be52688d43189fea335
--- /dev/null
+++ b/node/node_modules/json-bigint/package.json
@@ -0,0 +1,34 @@
+{
+ "name": "json-bigint",
+ "version": "1.0.0",
+ "description": "JSON.parse with bigints support",
+ "main": "index.js",
+ "files": [
+ "index.js",
+ "lib/parse.js",
+ "lib/stringify.js"
+ ],
+ "scripts": {
+ "test": "./node_modules/mocha/bin/mocha -R spec --check-leaks test/*-test.js"
+ },
+ "repository": {
+ "type": "git",
+ "url": "git@github.com:sidorares/json-bigint.git"
+ },
+ "keywords": [
+ "JSON",
+ "bigint",
+ "bignumber",
+ "parse",
+ "json"
+ ],
+ "author": "Andrey Sidorov + + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. + +
Promise<[Response](#class-response)>
+
+Perform an HTTP(S) fetch.
+
+`url` should be an absolute url, such as `https://example.com/`. A path-relative URL (`/file/under/root`) or protocol-relative URL (`//can-be-http-or-https.com/`) will result in a rejected `Promise`.
+
+
+### Options
+
+The default values are shown after each option key.
+
+```js
+{
+ // These properties are part of the Fetch Standard
+ method: 'GET',
+ headers: {}, // request headers. format is the identical to that accepted by the Headers constructor (see below)
+ body: null, // request body. can be null, a string, a Buffer, a Blob, or a Node.js Readable stream
+ redirect: 'follow', // set to `manual` to extract redirect headers, `error` to reject redirect
+ signal: null, // pass an instance of AbortSignal to optionally abort requests
+
+ // The following properties are node-fetch extensions
+ follow: 20, // maximum redirect count. 0 to not follow redirect
+ timeout: 0, // req/res timeout in ms, it resets on redirect. 0 to disable (OS limit applies). Signal is recommended instead.
+ compress: true, // support gzip/deflate content encoding. false to disable
+ size: 0, // maximum response body size in bytes. 0 to disable
+ agent: null // http(s).Agent instance or function that returns an instance (see below)
+}
+```
+
+##### Default Headers
+
+If no values are set, the following request headers will be sent automatically:
+
+Header | Value
+------------------- | --------------------------------------------------------
+`Accept-Encoding` | `gzip,deflate` _(when `options.compress === true`)_
+`Accept` | `*/*`
+`Content-Length` | _(automatically calculated, if possible)_
+`Transfer-Encoding` | `chunked` _(when `req.body` is a stream)_
+`User-Agent` | `node-fetch/1.0 (+https://github.com/bitinn/node-fetch)`
+
+Note: when `body` is a `Stream`, `Content-Length` is not set automatically.
+
+##### Custom Agent
+
+The `agent` option allows you to specify networking related options which are out of the scope of Fetch, including and not limited to the following:
+
+- Support self-signed certificate
+- Use only IPv4 or IPv6
+- Custom DNS Lookup
+
+See [`http.Agent`](https://nodejs.org/api/http.html#http_new_agent_options) for more information.
+
+If no agent is specified, the default agent provided by Node.js is used. Note that [this changed in Node.js 19](https://github.com/nodejs/node/blob/4267b92604ad78584244488e7f7508a690cb80d0/lib/_http_agent.js#L564) to have `keepalive` true by default. If you wish to enable `keepalive` in an earlier version of Node.js, you can override the agent as per the following code sample.
+
+In addition, the `agent` option accepts a function that returns `http`(s)`.Agent` instance given current [URL](https://nodejs.org/api/url.html), this is useful during a redirection chain across HTTP and HTTPS protocol.
+
+```js
+const httpAgent = new http.Agent({
+ keepAlive: true
+});
+const httpsAgent = new https.Agent({
+ keepAlive: true
+});
+
+const options = {
+ agent: function (_parsedURL) {
+ if (_parsedURL.protocol == 'http:') {
+ return httpAgent;
+ } else {
+ return httpsAgent;
+ }
+ }
+}
+```
+
+
+### Class: Request
+
+An HTTP(S) request containing information about URL, method, headers, and the body. This class implements the [Body](#iface-body) interface.
+
+Due to the nature of Node.js, the following properties are not implemented at this moment:
+
+- `type`
+- `destination`
+- `referrer`
+- `referrerPolicy`
+- `mode`
+- `credentials`
+- `cache`
+- `integrity`
+- `keepalive`
+
+The following node-fetch extension properties are provided:
+
+- `follow`
+- `compress`
+- `counter`
+- `agent`
+
+See [options](#fetch-options) for exact meaning of these extensions.
+
+#### new Request(input[, options])
+
+*(spec-compliant)*
+
+- `input` A string representing a URL, or another `Request` (which will be cloned)
+- `options` [Options][#fetch-options] for the HTTP(S) request
+
+Constructs a new `Request` object. The constructor is identical to that in the [browser](https://developer.mozilla.org/en-US/docs/Web/API/Request/Request).
+
+In most cases, directly `fetch(url, options)` is simpler than creating a `Request` object.
+
+
+### Class: Response
+
+An HTTP(S) response. This class implements the [Body](#iface-body) interface.
+
+The following properties are not implemented in node-fetch at this moment:
+
+- `Response.error()`
+- `Response.redirect()`
+- `type`
+- `trailer`
+
+#### new Response([body[, options]])
+
+*(spec-compliant)*
+
+- `body` A `String` or [`Readable` stream][node-readable]
+- `options` A [`ResponseInit`][response-init] options dictionary
+
+Constructs a new `Response` object. The constructor is identical to that in the [browser](https://developer.mozilla.org/en-US/docs/Web/API/Response/Response).
+
+Because Node.js does not implement service workers (for which this class was designed), one rarely has to construct a `Response` directly.
+
+#### response.ok
+
+*(spec-compliant)*
+
+Convenience property representing if the request ended normally. Will evaluate to true if the response status was greater than or equal to 200 but smaller than 300.
+
+#### response.redirected
+
+*(spec-compliant)*
+
+Convenience property representing if the request has been redirected at least once. Will evaluate to true if the internal redirect counter is greater than 0.
+
+
+### Class: Headers
+
+This class allows manipulating and iterating over a set of HTTP headers. All methods specified in the [Fetch Standard][whatwg-fetch] are implemented.
+
+#### new Headers([init])
+
+*(spec-compliant)*
+
+- `init` Optional argument to pre-fill the `Headers` object
+
+Construct a new `Headers` object. `init` can be either `null`, a `Headers` object, an key-value map object or any iterable object.
+
+```js
+// Example adapted from https://fetch.spec.whatwg.org/#example-headers-class
+
+const meta = {
+ 'Content-Type': 'text/xml',
+ 'Breaking-Bad': '<3'
+};
+const headers = new Headers(meta);
+
+// The above is equivalent to
+const meta = [
+ [ 'Content-Type', 'text/xml' ],
+ [ 'Breaking-Bad', '<3' ]
+];
+const headers = new Headers(meta);
+
+// You can in fact use any iterable objects, like a Map or even another Headers
+const meta = new Map();
+meta.set('Content-Type', 'text/xml');
+meta.set('Breaking-Bad', '<3');
+const headers = new Headers(meta);
+const copyOfHeaders = new Headers(headers);
+```
+
+
+### Interface: Body
+
+`Body` is an abstract interface with methods that are applicable to both `Request` and `Response` classes.
+
+The following methods are not yet implemented in node-fetch at this moment:
+
+- `formData()`
+
+#### body.body
+
+*(deviation from spec)*
+
+* Node.js [`Readable` stream][node-readable]
+
+Data are encapsulated in the `Body` object. Note that while the [Fetch Standard][whatwg-fetch] requires the property to always be a WHATWG `ReadableStream`, in node-fetch it is a Node.js [`Readable` stream][node-readable].
+
+#### body.bodyUsed
+
+*(spec-compliant)*
+
+* `Boolean`
+
+A boolean property for if this body has been consumed. Per the specs, a consumed body cannot be used again.
+
+#### body.arrayBuffer()
+#### body.blob()
+#### body.json()
+#### body.text()
+
+*(spec-compliant)*
+
+* Returns: Promise
+
+Consume the body and return a promise that will resolve to one of these formats.
+
+#### body.buffer()
+
+*(node-fetch extension)*
+
+* Returns: Promise<Buffer>
+
+Consume the body and return a promise that will resolve to a Buffer.
+
+#### body.textConverted()
+
+*(node-fetch extension)*
+
+* Returns: Promise<String>
+
+Identical to `body.text()`, except instead of always converting to UTF-8, encoding sniffing will be performed and text converted to UTF-8 if possible.
+
+(This API requires an optional dependency of the npm package [encoding](https://www.npmjs.com/package/encoding), which you need to install manually. `webpack` users may see [a warning message](https://github.com/bitinn/node-fetch/issues/412#issuecomment-379007792) due to this optional dependency.)
+
+
+### Class: FetchError
+
+*(node-fetch extension)*
+
+An operational error in the fetching process. See [ERROR-HANDLING.md][] for more info.
+
+
+### Class: AbortError
+
+*(node-fetch extension)*
+
+An Error thrown when the request is aborted in response to an `AbortSignal`'s `abort` event. It has a `name` property of `AbortError`. See [ERROR-HANDLING.MD][] for more info.
+
+## Acknowledgement
+
+Thanks to [github/fetch](https://github.com/github/fetch) for providing a solid implementation reference.
+
+`node-fetch` v1 was maintained by [@bitinn](https://github.com/bitinn); v2 was maintained by [@TimothyGu](https://github.com/timothygu), [@bitinn](https://github.com/bitinn) and [@jimmywarting](https://github.com/jimmywarting); v2 readme is written by [@jkantr](https://github.com/jkantr).
+
+## License
+
+MIT
+
+[npm-image]: https://flat.badgen.net/npm/v/node-fetch
+[npm-url]: https://www.npmjs.com/package/node-fetch
+[travis-image]: https://flat.badgen.net/travis/bitinn/node-fetch
+[travis-url]: https://travis-ci.org/bitinn/node-fetch
+[codecov-image]: https://flat.badgen.net/codecov/c/github/bitinn/node-fetch/master
+[codecov-url]: https://codecov.io/gh/bitinn/node-fetch
+[install-size-image]: https://flat.badgen.net/packagephobia/install/node-fetch
+[install-size-url]: https://packagephobia.now.sh/result?p=node-fetch
+[discord-image]: https://img.shields.io/discord/619915844268326952?color=%237289DA&label=Discord&style=flat-square
+[discord-url]: https://discord.gg/Zxbndcm
+[opencollective-image]: https://opencollective.com/node-fetch/backers.svg
+[opencollective-url]: https://opencollective.com/node-fetch
+[whatwg-fetch]: https://fetch.spec.whatwg.org/
+[response-init]: https://fetch.spec.whatwg.org/#responseinit
+[node-readable]: https://nodejs.org/api/stream.html#stream_readable_streams
+[mdn-headers]: https://developer.mozilla.org/en-US/docs/Web/API/Headers
+[LIMITS.md]: https://github.com/bitinn/node-fetch/blob/master/LIMITS.md
+[ERROR-HANDLING.md]: https://github.com/bitinn/node-fetch/blob/master/ERROR-HANDLING.md
+[UPGRADE-GUIDE.md]: https://github.com/bitinn/node-fetch/blob/master/UPGRADE-GUIDE.md
diff --git a/node/node_modules/node-fetch/browser.js b/node/node_modules/node-fetch/browser.js
new file mode 100644
index 0000000000000000000000000000000000000000..ee86265ae3adab9f03cf10f486384735417320e6
--- /dev/null
+++ b/node/node_modules/node-fetch/browser.js
@@ -0,0 +1,25 @@
+"use strict";
+
+// ref: https://github.com/tc39/proposal-global
+var getGlobal = function () {
+ // the only reliable means to get the global object is
+ // `Function('return this')()`
+ // However, this causes CSP violations in Chrome apps.
+ if (typeof self !== 'undefined') { return self; }
+ if (typeof window !== 'undefined') { return window; }
+ if (typeof global !== 'undefined') { return global; }
+ throw new Error('unable to locate global object');
+}
+
+var globalObject = getGlobal();
+
+module.exports = exports = globalObject.fetch;
+
+// Needed for TypeScript and Webpack.
+if (globalObject.fetch) {
+ exports.default = globalObject.fetch.bind(globalObject);
+}
+
+exports.Headers = globalObject.Headers;
+exports.Request = globalObject.Request;
+exports.Response = globalObject.Response;
diff --git a/node/node_modules/node-fetch/lib/index.es.js b/node/node_modules/node-fetch/lib/index.es.js
new file mode 100644
index 0000000000000000000000000000000000000000..aae9799c1a8798d5899ffed6deda4c98b7007b48
--- /dev/null
+++ b/node/node_modules/node-fetch/lib/index.es.js
@@ -0,0 +1,1777 @@
+process.emitWarning("The .es.js file is deprecated. Use .mjs instead.");
+
+import Stream from 'stream';
+import http from 'http';
+import Url from 'url';
+import whatwgUrl from 'whatwg-url';
+import https from 'https';
+import zlib from 'zlib';
+
+// Based on https://github.com/tmpvar/jsdom/blob/aa85b2abf07766ff7bf5c1f6daafb3726f2f2db5/lib/jsdom/living/blob.js
+
+// fix for "Readable" isn't a named export issue
+const Readable = Stream.Readable;
+
+const BUFFER = Symbol('buffer');
+const TYPE = Symbol('type');
+
+class Blob {
+ constructor() {
+ this[TYPE] = '';
+
+ const blobParts = arguments[0];
+ const options = arguments[1];
+
+ const buffers = [];
+ let size = 0;
+
+ if (blobParts) {
+ const a = blobParts;
+ const length = Number(a.length);
+ for (let i = 0; i < length; i++) {
+ const element = a[i];
+ let buffer;
+ if (element instanceof Buffer) {
+ buffer = element;
+ } else if (ArrayBuffer.isView(element)) {
+ buffer = Buffer.from(element.buffer, element.byteOffset, element.byteLength);
+ } else if (element instanceof ArrayBuffer) {
+ buffer = Buffer.from(element);
+ } else if (element instanceof Blob) {
+ buffer = element[BUFFER];
+ } else {
+ buffer = Buffer.from(typeof element === 'string' ? element : String(element));
+ }
+ size += buffer.length;
+ buffers.push(buffer);
+ }
+ }
+
+ this[BUFFER] = Buffer.concat(buffers);
+
+ let type = options && options.type !== undefined && String(options.type).toLowerCase();
+ if (type && !/[^\u0020-\u007E]/.test(type)) {
+ this[TYPE] = type;
+ }
+ }
+ get size() {
+ return this[BUFFER].length;
+ }
+ get type() {
+ return this[TYPE];
+ }
+ text() {
+ return Promise.resolve(this[BUFFER].toString());
+ }
+ arrayBuffer() {
+ const buf = this[BUFFER];
+ const ab = buf.buffer.slice(buf.byteOffset, buf.byteOffset + buf.byteLength);
+ return Promise.resolve(ab);
+ }
+ stream() {
+ const readable = new Readable();
+ readable._read = function () {};
+ readable.push(this[BUFFER]);
+ readable.push(null);
+ return readable;
+ }
+ toString() {
+ return '[object Blob]';
+ }
+ slice() {
+ const size = this.size;
+
+ const start = arguments[0];
+ const end = arguments[1];
+ let relativeStart, relativeEnd;
+ if (start === undefined) {
+ relativeStart = 0;
+ } else if (start < 0) {
+ relativeStart = Math.max(size + start, 0);
+ } else {
+ relativeStart = Math.min(start, size);
+ }
+ if (end === undefined) {
+ relativeEnd = size;
+ } else if (end < 0) {
+ relativeEnd = Math.max(size + end, 0);
+ } else {
+ relativeEnd = Math.min(end, size);
+ }
+ const span = Math.max(relativeEnd - relativeStart, 0);
+
+ const buffer = this[BUFFER];
+ const slicedBuffer = buffer.slice(relativeStart, relativeStart + span);
+ const blob = new Blob([], { type: arguments[2] });
+ blob[BUFFER] = slicedBuffer;
+ return blob;
+ }
+}
+
+Object.defineProperties(Blob.prototype, {
+ size: { enumerable: true },
+ type: { enumerable: true },
+ slice: { enumerable: true }
+});
+
+Object.defineProperty(Blob.prototype, Symbol.toStringTag, {
+ value: 'Blob',
+ writable: false,
+ enumerable: false,
+ configurable: true
+});
+
+/**
+ * fetch-error.js
+ *
+ * FetchError interface for operational errors
+ */
+
+/**
+ * Create FetchError instance
+ *
+ * @param String message Error message for human
+ * @param String type Error type for machine
+ * @param String systemError For Node.js system error
+ * @return FetchError
+ */
+function FetchError(message, type, systemError) {
+ Error.call(this, message);
+
+ this.message = message;
+ this.type = type;
+
+ // when err.type is `system`, err.code contains system error code
+ if (systemError) {
+ this.code = this.errno = systemError.code;
+ }
+
+ // hide custom error implementation details from end-users
+ Error.captureStackTrace(this, this.constructor);
+}
+
+FetchError.prototype = Object.create(Error.prototype);
+FetchError.prototype.constructor = FetchError;
+FetchError.prototype.name = 'FetchError';
+
+let convert;
+try {
+ convert = require('encoding').convert;
+} catch (e) {}
+
+const INTERNALS = Symbol('Body internals');
+
+// fix an issue where "PassThrough" isn't a named export for node <10
+const PassThrough = Stream.PassThrough;
+
+/**
+ * Body mixin
+ *
+ * Ref: https://fetch.spec.whatwg.org/#body
+ *
+ * @param Stream body Readable stream
+ * @param Object opts Response options
+ * @return Void
+ */
+function Body(body) {
+ var _this = this;
+
+ var _ref = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {},
+ _ref$size = _ref.size;
+
+ let size = _ref$size === undefined ? 0 : _ref$size;
+ var _ref$timeout = _ref.timeout;
+ let timeout = _ref$timeout === undefined ? 0 : _ref$timeout;
+
+ if (body == null) {
+ // body is undefined or null
+ body = null;
+ } else if (isURLSearchParams(body)) {
+ // body is a URLSearchParams
+ body = Buffer.from(body.toString());
+ } else if (isBlob(body)) ; else if (Buffer.isBuffer(body)) ; else if (Object.prototype.toString.call(body) === '[object ArrayBuffer]') {
+ // body is ArrayBuffer
+ body = Buffer.from(body);
+ } else if (ArrayBuffer.isView(body)) {
+ // body is ArrayBufferView
+ body = Buffer.from(body.buffer, body.byteOffset, body.byteLength);
+ } else if (body instanceof Stream) ; else {
+ // none of the above
+ // coerce to string then buffer
+ body = Buffer.from(String(body));
+ }
+ this[INTERNALS] = {
+ body,
+ disturbed: false,
+ error: null
+ };
+ this.size = size;
+ this.timeout = timeout;
+
+ if (body instanceof Stream) {
+ body.on('error', function (err) {
+ const error = err.name === 'AbortError' ? err : new FetchError(`Invalid response body while trying to fetch ${_this.url}: ${err.message}`, 'system', err);
+ _this[INTERNALS].error = error;
+ });
+ }
+}
+
+Body.prototype = {
+ get body() {
+ return this[INTERNALS].body;
+ },
+
+ get bodyUsed() {
+ return this[INTERNALS].disturbed;
+ },
+
+ /**
+ * Decode response as ArrayBuffer
+ *
+ * @return Promise
+ */
+ arrayBuffer() {
+ return consumeBody.call(this).then(function (buf) {
+ return buf.buffer.slice(buf.byteOffset, buf.byteOffset + buf.byteLength);
+ });
+ },
+
+ /**
+ * Return raw response as Blob
+ *
+ * @return Promise
+ */
+ blob() {
+ let ct = this.headers && this.headers.get('content-type') || '';
+ return consumeBody.call(this).then(function (buf) {
+ return Object.assign(
+ // Prevent copying
+ new Blob([], {
+ type: ct.toLowerCase()
+ }), {
+ [BUFFER]: buf
+ });
+ });
+ },
+
+ /**
+ * Decode response as json
+ *
+ * @return Promise
+ */
+ json() {
+ var _this2 = this;
+
+ return consumeBody.call(this).then(function (buffer) {
+ try {
+ return JSON.parse(buffer.toString());
+ } catch (err) {
+ return Body.Promise.reject(new FetchError(`invalid json response body at ${_this2.url} reason: ${err.message}`, 'invalid-json'));
+ }
+ });
+ },
+
+ /**
+ * Decode response as text
+ *
+ * @return Promise
+ */
+ text() {
+ return consumeBody.call(this).then(function (buffer) {
+ return buffer.toString();
+ });
+ },
+
+ /**
+ * Decode response as buffer (non-spec api)
+ *
+ * @return Promise
+ */
+ buffer() {
+ return consumeBody.call(this);
+ },
+
+ /**
+ * Decode response as text, while automatically detecting the encoding and
+ * trying to decode to UTF-8 (non-spec api)
+ *
+ * @return Promise
+ */
+ textConverted() {
+ var _this3 = this;
+
+ return consumeBody.call(this).then(function (buffer) {
+ return convertBody(buffer, _this3.headers);
+ });
+ }
+};
+
+// In browsers, all properties are enumerable.
+Object.defineProperties(Body.prototype, {
+ body: { enumerable: true },
+ bodyUsed: { enumerable: true },
+ arrayBuffer: { enumerable: true },
+ blob: { enumerable: true },
+ json: { enumerable: true },
+ text: { enumerable: true }
+});
+
+Body.mixIn = function (proto) {
+ for (const name of Object.getOwnPropertyNames(Body.prototype)) {
+ // istanbul ignore else: future proof
+ if (!(name in proto)) {
+ const desc = Object.getOwnPropertyDescriptor(Body.prototype, name);
+ Object.defineProperty(proto, name, desc);
+ }
+ }
+};
+
+/**
+ * Consume and convert an entire Body to a Buffer.
+ *
+ * Ref: https://fetch.spec.whatwg.org/#concept-body-consume-body
+ *
+ * @return Promise
+ */
+function consumeBody() {
+ var _this4 = this;
+
+ if (this[INTERNALS].disturbed) {
+ return Body.Promise.reject(new TypeError(`body used already for: ${this.url}`));
+ }
+
+ this[INTERNALS].disturbed = true;
+
+ if (this[INTERNALS].error) {
+ return Body.Promise.reject(this[INTERNALS].error);
+ }
+
+ let body = this.body;
+
+ // body is null
+ if (body === null) {
+ return Body.Promise.resolve(Buffer.alloc(0));
+ }
+
+ // body is blob
+ if (isBlob(body)) {
+ body = body.stream();
+ }
+
+ // body is buffer
+ if (Buffer.isBuffer(body)) {
+ return Body.Promise.resolve(body);
+ }
+
+ // istanbul ignore if: should never happen
+ if (!(body instanceof Stream)) {
+ return Body.Promise.resolve(Buffer.alloc(0));
+ }
+
+ // body is stream
+ // get ready to actually consume the body
+ let accum = [];
+ let accumBytes = 0;
+ let abort = false;
+
+ return new Body.Promise(function (resolve, reject) {
+ let resTimeout;
+
+ // allow timeout on slow response body
+ if (_this4.timeout) {
+ resTimeout = setTimeout(function () {
+ abort = true;
+ reject(new FetchError(`Response timeout while trying to fetch ${_this4.url} (over ${_this4.timeout}ms)`, 'body-timeout'));
+ }, _this4.timeout);
+ }
+
+ // handle stream errors
+ body.on('error', function (err) {
+ if (err.name === 'AbortError') {
+ // if the request was aborted, reject with this Error
+ abort = true;
+ reject(err);
+ } else {
+ // other errors, such as incorrect content-encoding
+ reject(new FetchError(`Invalid response body while trying to fetch ${_this4.url}: ${err.message}`, 'system', err));
+ }
+ });
+
+ body.on('data', function (chunk) {
+ if (abort || chunk === null) {
+ return;
+ }
+
+ if (_this4.size && accumBytes + chunk.length > _this4.size) {
+ abort = true;
+ reject(new FetchError(`content size at ${_this4.url} over limit: ${_this4.size}`, 'max-size'));
+ return;
+ }
+
+ accumBytes += chunk.length;
+ accum.push(chunk);
+ });
+
+ body.on('end', function () {
+ if (abort) {
+ return;
+ }
+
+ clearTimeout(resTimeout);
+
+ try {
+ resolve(Buffer.concat(accum, accumBytes));
+ } catch (err) {
+ // handle streams that have accumulated too much data (issue #414)
+ reject(new FetchError(`Could not create Buffer from response body for ${_this4.url}: ${err.message}`, 'system', err));
+ }
+ });
+ });
+}
+
+/**
+ * Detect buffer encoding and convert to target encoding
+ * ref: http://www.w3.org/TR/2011/WD-html5-20110113/parsing.html#determining-the-character-encoding
+ *
+ * @param Buffer buffer Incoming buffer
+ * @param String encoding Target encoding
+ * @return String
+ */
+function convertBody(buffer, headers) {
+ if (typeof convert !== 'function') {
+ throw new Error('The package `encoding` must be installed to use the textConverted() function');
+ }
+
+ const ct = headers.get('content-type');
+ let charset = 'utf-8';
+ let res, str;
+
+ // header
+ if (ct) {
+ res = /charset=([^;]*)/i.exec(ct);
+ }
+
+ // no charset in content type, peek at response body for at most 1024 bytes
+ str = buffer.slice(0, 1024).toString();
+
+ // html5
+ if (!res && str) {
+ res = /-
+
-
+
+ scene-icon-25++
+
+
-
+
+ 时钟++
+
+
-
+
+ 个人_物业费提取(menuicon_wyftq)++
+
+
-
+
+ 洗衣机++
+
+
-
+
+ 沙发++
+
+
-
+
+ 扳手++
+
+
-
+
+ uniE78D++
+
+
-
+
+ 支付宝支付++
+
-
3.1-客服@@ -180,9 +228,9 @@
@font-face { font-family: 'iconfont'; - src: url('iconfont.woff2?t=1710298973478') format('woff2'), - url('iconfont.woff?t=1710298973478') format('woff'), - url('iconfont.ttf?t=1710298973478') format('truetype'); + src: url('iconfont.woff2?t=1710609130416') format('woff2'), + url('iconfont.woff?t=1710609130416') format('woff'), + url('iconfont.ttf?t=1710609130416') format('truetype'); }第二步：定义使用 iconfont 的样式
@@ -208,6 +256,78 @@-
+
-
+
+ + scene-icon-25 ++.icon-scene-icon-25 ++
+
+
-
+
+ + 时钟 ++.icon-shizhong ++
+
+
-
+
+ + 个人_物业费提取(menuicon_wyftq) ++.icon-geren_wuyefeitiqumenuicon_wyftq ++
+
+
-
+
+ + 洗衣机 ++.icon-xiyiji1 ++
+
+
-
+
+ + 沙发 ++.icon-shafa ++
+
+
-
+
+ + 扳手 ++.icon-banshou1 ++
+
+
-
+
+ + uniE78D ++.icon-uniE78D ++
+
+
-
+
+ + 支付宝支付 ++.icon-zhifubaozhifu ++
+
-
@@ -397,6 +517,70 @@
-
+
- +
-
+
+